5-chloro-2-(4-(2-(2-hydroxyethoxy)ethyl)piperazin-1-yl)-N-(6-(3-methoxybenzamido)pyridin-3-yl)isonicotinamide
Internal ID | d5e18777-59ca-490e-811b-d12f174a27d9 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Iridoid O-glycosides |
IUPAC Name | methyl 7-hydroxy-7-methyl-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4a,5,6,7a-tetrahydro-1H-cyclopenta[c]pyran-4-carboxylate |
SMILES (Canonical) | CC1(CCC2C1C(OC=C2C(=O)OC)OC3C(C(C(C(O3)CO)O)O)O)O |
SMILES (Isomeric) | CC1(CCC2C1C(OC=C2C(=O)OC)OC3C(C(C(C(O3)CO)O)O)O)O |
InChI | InChI=1S/C17H26O10/c1-17(23)4-3-7-8(14(22)24-2)6-25-15(10(7)17)27-16-13(21)12(20)11(19)9(5-18)26-16/h6-7,9-13,15-16,18-21,23H,3-5H2,1-2H3 |
InChI Key | XBGJTRDIWPEIMG-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C17H26O10 |
Molecular Weight | 390.40 g/mol |
Exact Mass | 390.15259702 g/mol |
Topological Polar Surface Area (TPSA) | 155.00 Ų |
XlogP | -1.60 |
5-chloro-2-(4-(2-(2-hydroxyethoxy)ethyl)piperazin-1-yl)-N-(6-(3-methoxybenzamido)pyridin-3-yl)isonicotinamide |
CHEBI:181223 |
AKOS032948708 |
B0005-146501 |
methyl 7-hydroxy-7-methyl-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4a,5,6,7a-tetrahydro-1H-cyclopenta[c]pyran-4-carboxylate |
![2D Structure of 5-chloro-2-(4-(2-(2-hydroxyethoxy)ethyl)piperazin-1-yl)-N-(6-(3-methoxybenzamido)pyridin-3-yl)isonicotinamide 2D Structure of 5-chloro-2-(4-(2-(2-hydroxyethoxy)ethyl)piperazin-1-yl)-N-(6-(3-methoxybenzamido)pyridin-3-yl)isonicotinamide](https://plantaedb.com/storage/docs/compounds/2023/11/66c5c540-8620-11ee-8916-c36ac867f52d.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.26% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.16% | 91.11% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.49% | 97.09% |
CHEMBL4208 | P20618 | Proteasome component C5 | 86.69% | 90.00% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 86.32% | 92.50% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 85.59% | 96.61% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.33% | 95.89% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 84.43% | 95.83% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.07% | 100.00% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 82.73% | 86.92% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.64% | 95.89% |
CHEMBL2581 | P07339 | Cathepsin D | 82.09% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.42% | 86.33% |
CHEMBL5028 | O14672 | ADAM10 | 81.39% | 97.50% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 81.23% | 91.24% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 81.03% | 85.14% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 80.85% | 100.00% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 80.47% | 97.25% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 80.17% | 95.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 13848072 |
LOTUS | LTS0201274 |
wikiData | Q105324418 |