6-Methoxy-2-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole
| Internal ID | 678ad900-6881-452d-b84b-9e7e5b0146a6 |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Pyridoindoles > Beta carbolines |
| IUPAC Name | 6-methoxy-2-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES (Canonical) | CN1CCC2=C(C1)NC3=C2C=C(C=C3)OC |
| SMILES (Isomeric) | CN1CCC2=C(C1)NC3=C2C=C(C=C3)OC |
| InChI | InChI=1S/C13H16N2O/c1-15-6-5-10-11-7-9(16-2)3-4-12(11)14-13(10)8-15/h3-4,7,14H,5-6,8H2,1-2H3 |
| InChI Key | WOIXRQJXGWXSBU-UHFFFAOYSA-N |
| Popularity | 4 references in papers |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.126263138 g/mol |
| Topological Polar Surface Area (TPSA) | 28.30 Ų |
| XlogP | 1.90 |
| N-Methylpinoline |
| 6-methoxy-2-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| 6582-80-5 |
| 5R59U3R5MP |
| SCHEMBL12083125 |
| TQP1248 |
| 6-Methoxy-2-methyl-1,2,3,4-tetrahydro-beta-carboline |
| 6-methoxy-2-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole |
| H-Pyrido[3,4-b]indole, 2,3,4,9-tetrahydro-6-methoxy-2-methyl- |
![2D Structure of 6-Methoxy-2-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole](https://plantaedb.com/storage/docs/compounds/2023/11/6-methoxy-2-methyl-1349-tetrahydropyrido34-bindole.jpg "2D Structure of 6-Methoxy-2-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.34% | 96.09% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 96.99% | 93.40% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.12% | 94.45% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.37% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.24% | 95.56% |
| CHEMBL2535 | P11166 | Glucose transporter | 94.99% | 98.75% |
| CHEMBL5747 | Q92793 | CREB-binding protein | 94.08% | 95.12% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 93.95% | 90.00% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 93.60% | 93.99% |
| CHEMBL2056 | P21728 | Dopamine D1 receptor | 92.58% | 91.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.44% | 98.95% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 90.86% | 91.49% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.45% | 95.89% |
| CHEMBL2146302 | O94925 | Glutaminase kidney isoform, mitochondrial | 86.13% | 100.00% |
| CHEMBL1871 | P10275 | Androgen Receptor | 85.94% | 96.43% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 85.60% | 98.59% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.82% | 94.00% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 82.78% | 93.65% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 81.85% | 92.94% |
| CHEMBL2782 | P35610 | Acyl coenzyme A:cholesterol acyltransferase 1 | 81.74% | 91.65% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 81.15% | 93.31% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Horsfieldia superba |
| Meconopsis napaulensis |
| Phalaris aquatica |
| Phalaris arundinacea |
| Phalaris coerulescens |
| Phyllodium pulchellum |
| Stenostomum lucidum |
| PubChem | 5319717 |
| LOTUS | LTS0229718 |
| wikiData | Q104200470 |