2-[4,5-Dihydroxy-6-(hydroxymethyl)-2-[[6-methoxy-7,9,13-trimethyl-6-[3-methyl-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutyl]-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-en-16-yl]oxy]oxan-3-yl]oxy-6-methyloxane-3,4,5-triol
Internal ID | c459ab01-5f71-4052-8eb2-72103251f4d2 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins |
IUPAC Name | 2-[4,5-dihydroxy-6-(hydroxymethyl)-2-[[6-methoxy-7,9,13-trimethyl-6-[3-methyl-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutyl]-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-en-16-yl]oxy]oxan-3-yl]oxy-6-methyloxane-3,4,5-triol |
SMILES (Canonical) | CC1C2C(CC3C2(CCC4C3CC=C5C4(CCC(C5)OC6C(C(C(C(O6)CO)O)O)OC7C(C(C(C(O7)C)O)O)O)C)C)OC1(CCC(C)COC8C(C(C(C(O8)CO)O)O)O)OC |
SMILES (Isomeric) | CC1C2C(CC3C2(CCC4C3CC=C5C4(CCC(C5)OC6C(C(C(C(O6)CO)O)O)OC7C(C(C(C(O7)C)O)O)O)C)C)OC1(CCC(C)COC8C(C(C(C(O8)CO)O)O)O)OC |
InChI | InChI=1S/C46H76O18/c1-20(19-58-41-38(55)36(53)33(50)29(17-47)61-41)9-14-46(57-6)21(2)31-28(64-46)16-27-25-8-7-23-15-24(10-12-44(23,4)26(25)11-13-45(27,31)5)60-43-40(37(54)34(51)30(18-48)62-43)63-42-39(56)35(52)32(49)22(3)59-42/h7,20-22,24-43,47-56H,8-19H2,1-6H3 |
InChI Key | MNJMFMOAMCOUES-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C46H76O18 |
Molecular Weight | 917.10 g/mol |
Exact Mass | 916.50316557 g/mol |
Topological Polar Surface Area (TPSA) | 276.00 Ų |
XlogP | 0.90 |
There are no found synonyms. |
![2D Structure of 2-[4,5-Dihydroxy-6-(hydroxymethyl)-2-[[6-methoxy-7,9,13-trimethyl-6-[3-methyl-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutyl]-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-en-16-yl]oxy]oxan-3-yl]oxy-6-methyloxane-3,4,5-triol 2D Structure of 2-[4,5-Dihydroxy-6-(hydroxymethyl)-2-[[6-methoxy-7,9,13-trimethyl-6-[3-methyl-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutyl]-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-en-16-yl]oxy]oxan-3-yl]oxy-6-methyloxane-3,4,5-triol](https://plantaedb.com/storage/docs/compounds/2023/11/5baf4ca0-8645-11ee-9417-258209f24a80.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.01% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.67% | 91.11% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 97.66% | 95.93% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.35% | 97.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.16% | 94.45% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 91.83% | 100.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 90.98% | 95.89% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 90.45% | 97.25% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 90.12% | 94.08% |
CHEMBL2581 | P07339 | Cathepsin D | 89.00% | 98.95% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.84% | 95.89% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 88.81% | 93.56% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 88.33% | 89.05% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.14% | 89.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 85.99% | 94.73% |
CHEMBL2094135 | Q96BI3 | Gamma-secretase | 85.77% | 98.05% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 85.36% | 96.61% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.33% | 86.33% |
CHEMBL237 | P41145 | Kappa opioid receptor | 84.94% | 98.10% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 84.10% | 94.75% |
CHEMBL2140 | P48775 | Tryptophan 2,3-dioxygenase | 83.90% | 98.46% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 82.92% | 100.00% |
CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 82.81% | 94.23% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 82.40% | 100.00% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 81.70% | 92.86% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.27% | 94.00% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 81.11% | 100.00% |
CHEMBL4581 | P52732 | Kinesin-like protein 1 | 80.48% | 93.18% |
CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 80.30% | 86.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Cardiocrinum cordatum |
Lilium candidum |
Maianthemum atropurpureum |
Phoenix dactylifera |
Rhapis humilis |
PubChem | 74429158 |
LOTUS | LTS0107644 |
wikiData | Q105168411 |