(1R,4S,8S,9S,10S,12R)-9-[2-(furan-3-yl)ethyl]-9,10-dihydroxy-4,8,10-trimethyl-2-oxatricyclo[6.3.1.04,12]dodecan-3-one
Internal ID | c25c49df-5110-4b60-91f2-e040b9d3dd98 |
Taxonomy | Organoheterocyclic compounds > Lactones > Gamma butyrolactones |
IUPAC Name | (1R,4S,8S,9S,10S,12R)-9-[2-(furan-3-yl)ethyl]-9,10-dihydroxy-4,8,10-trimethyl-2-oxatricyclo[6.3.1.04,12]dodecan-3-one |
SMILES (Canonical) | CC12CCCC3(C1C(CC(C3(CCC4=COC=C4)O)(C)O)OC2=O)C |
SMILES (Isomeric) | C[C@]12CCC[C@]3([C@H]1[C@@H](C[C@]([C@@]3(CCC4=COC=C4)O)(C)O)OC2=O)C |
InChI | InChI=1S/C20H28O5/c1-17-7-4-8-18(2)15(17)14(25-16(17)21)11-19(3,22)20(18,23)9-5-13-6-10-24-12-13/h6,10,12,14-15,22-23H,4-5,7-9,11H2,1-3H3/t14-,15+,17+,18+,19+,20+/m1/s1 |
InChI Key | FJNCXZZQNBKEJT-CARQVRACSA-N |
Popularity | 0 references in papers |
Molecular Formula | C20H28O5 |
Molecular Weight | 348.40 g/mol |
Exact Mass | 348.19367399 g/mol |
Topological Polar Surface Area (TPSA) | 79.90 Ų |
XlogP | 2.50 |
There are no found synonyms. |
![2D Structure of (1R,4S,8S,9S,10S,12R)-9-[2-(furan-3-yl)ethyl]-9,10-dihydroxy-4,8,10-trimethyl-2-oxatricyclo[6.3.1.04,12]dodecan-3-one 2D Structure of (1R,4S,8S,9S,10S,12R)-9-[2-(furan-3-yl)ethyl]-9,10-dihydroxy-4,8,10-trimethyl-2-oxatricyclo[6.3.1.04,12]dodecan-3-one](https://plantaedb.com/storage/docs/compounds/2023/11/54b5e000-84ce-11ee-8983-1d6b94ece0d2.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.98% | 94.45% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.13% | 97.25% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.29% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.76% | 96.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.51% | 85.14% |
CHEMBL2581 | P07339 | Cathepsin D | 90.05% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.39% | 86.33% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.26% | 97.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.16% | 95.56% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.51% | 89.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.71% | 95.89% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.20% | 100.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 80.23% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Leonotis nepetifolia |
Leonotis ocymifolia |
Leonurus sibiricus |
PubChem | 21582483 |
LOTUS | LTS0192837 |
wikiData | Q104996232 |