5-O-Methylhierochin D
Internal ID | e5bee5eb-2600-4aca-97e7-124e372470bf |
Taxonomy | Phenylpropanoids and polyketides > 2-arylbenzofuran flavonoids |
IUPAC Name | 4-[3-(hydroxymethyl)-5-(3-hydroxyprop-1-enyl)-7-methoxy-2,3-dihydro-1-benzofuran-2-yl]-2-methoxyphenol |
SMILES (Canonical) | COC1=CC(=CC2=C1OC(C2CO)C3=CC(=C(C=C3)O)OC)C=CCO |
SMILES (Isomeric) | COC1=CC(=CC2=C1OC(C2CO)C3=CC(=C(C=C3)O)OC)C=CCO |
InChI | InChI=1S/C20H22O6/c1-24-17-10-13(5-6-16(17)23)19-15(11-22)14-8-12(4-3-7-21)9-18(25-2)20(14)26-19/h3-6,8-10,15,19,21-23H,7,11H2,1-2H3 |
InChI Key | KUSXBOZNRPQEON-UHFFFAOYSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C20H22O6 |
Molecular Weight | 358.40 g/mol |
Exact Mass | 358.14163842 g/mol |
Topological Polar Surface Area (TPSA) | 88.40 Ų |
XlogP | 1.90 |
4-[3-(Hydroxymethyl)-5-(3-hydroxyprop-1-enyl)-7-methoxy-2,3-dihydro-1-benzofuran-2-yl]-2-methoxyphenol |
97465-82-2 |
DTXSID301311390 |
4-(3-[hydroxymethyl]-5-[3-hydroxyprop-1-enyl]-7-methoxy-2,3-dihydrobenz ofuran-2-yl)-2-methoxyphenol |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL206 | P03372 | Estrogen receptor alpha |
61.91 nM |
IC50 |
via Super-PRED
|
CHEMBL242 | Q92731 | Estrogen receptor beta |
286.5 nM |
IC50 |
via Super-PRED
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.49% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.69% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.99% | 95.56% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 92.78% | 96.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.49% | 86.33% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 91.20% | 85.14% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 89.78% | 86.92% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.25% | 99.17% |
CHEMBL3194 | P02766 | Transthyretin | 85.79% | 90.71% |
CHEMBL3401 | O75469 | Pregnane X receptor | 85.64% | 94.73% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.22% | 97.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.15% | 89.00% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 83.64% | 89.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 188976 |
LOTUS | LTS0092199 |
wikiData | Q105146345 |