5-Hydroxy-1-methoxyxanthone
Internal ID | 1b86c469-2185-45f8-9df6-4f804b264150 |
Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans > Xanthones |
IUPAC Name | 5-hydroxy-1-methoxyxanthen-9-one |
SMILES (Canonical) | COC1=CC=CC2=C1C(=O)C3=C(O2)C(=CC=C3)O |
SMILES (Isomeric) | COC1=CC=CC2=C1C(=O)C3=C(O2)C(=CC=C3)O |
InChI | InChI=1S/C14H10O4/c1-17-10-6-3-7-11-12(10)13(16)8-4-2-5-9(15)14(8)18-11/h2-7,15H,1H3 |
InChI Key | GCAMSSLNXVYMKS-UHFFFAOYSA-N |
Popularity | 7 references in papers |
Molecular Formula | C14H10O4 |
Molecular Weight | 242.23 g/mol |
Exact Mass | 242.05790880 g/mol |
Topological Polar Surface Area (TPSA) | 55.80 Ų |
XlogP | 2.60 |
27770-13-4 |
5-hydroxy-1-methoxyxanthen-9-one |
CHEMBL187159 |
Xanthen-9-one, 5-hydroxy-1-methoxy- |
5-Hydroxy-1-methoxy-9H-xanthen-9-one; 5-Hydroxy-1-methoxyxanthen-9-one; 5-Hydroxy-1-methoxyxanthone |
9H-Xanthen-9-one, 5-hydroxy-1-methoxy- |
DTXSID20333064 |
5-Hydroxy-1-methoxy-xanthen-9-one |
BDBM50155433 |
AKOS025288581 |
![2D Structure of 5-Hydroxy-1-methoxyxanthone 2D Structure of 5-Hydroxy-1-methoxyxanthone](https://plantaedb.com/storage/docs/compounds/2023/11/5-hydroxy-1-methoxyxanthone.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 97.10% | 95.56% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.33% | 91.11% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 94.31% | 94.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 93.74% | 99.23% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 93.10% | 93.99% |
CHEMBL2535 | P11166 | Glucose transporter | 92.38% | 98.75% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.80% | 89.00% |
CHEMBL2581 | P07339 | Cathepsin D | 91.59% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.20% | 86.33% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.93% | 94.45% |
CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 85.60% | 94.03% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 83.12% | 85.14% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 83.04% | 94.75% |
CHEMBL3401 | O75469 | Pregnane X receptor | 82.70% | 94.73% |
CHEMBL1907 | P15144 | Aminopeptidase N | 80.81% | 93.31% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 80.41% | 95.50% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.22% | 92.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Calophyllum thwaitesii |
Garcinia linii |
Hypericum brasiliense |
Mammea acuminata |
Mammea africana |
Mammea siamensis |
Marila laxiflora |
Mesua assamica |
Mesua ferrea |
PubChem | 479656 |
LOTUS | LTS0153684 |
wikiData | Q105258894 |