[4-[2-(3,4-Dihydroxyphenyl)-2-methoxyethoxy]-3-hydroxy-6-(hydroxymethyl)-2-(3,4,5,6-tetrahydroxyoxan-2-yl)oxycyclohexyl] 3-(3,4-dihydroxyphenyl)prop-2-enoate
Internal ID | 56a5bee9-cf09-4a86-8267-4bf4e35cb31e |
Taxonomy | Phenylpropanoids and polyketides > Cinnamic acids and derivatives > Hydroxycinnamic acids and derivatives > Coumaric acids and derivatives |
IUPAC Name | [4-[2-(3,4-dihydroxyphenyl)-2-methoxyethoxy]-3-hydroxy-6-(hydroxymethyl)-2-(3,4,5,6-tetrahydroxyoxan-2-yl)oxycyclohexyl] 3-(3,4-dihydroxyphenyl)prop-2-enoate |
SMILES (Canonical) | COC(COC1CC(C(C(C1O)OC2C(C(C(C(O2)O)O)O)O)OC(=O)C=CC3=CC(=C(C=C3)O)O)CO)C4=CC(=C(C=C4)O)O |
SMILES (Isomeric) | COC(COC1CC(C(C(C1O)OC2C(C(C(C(O2)O)O)O)O)OC(=O)C=CC3=CC(=C(C=C3)O)O)CO)C4=CC(=C(C=C4)O)O |
InChI | InChI=1S/C30H38O16/c1-42-21(14-4-6-17(33)19(35)9-14)12-43-20-10-15(11-31)27(44-22(36)7-3-13-2-5-16(32)18(34)8-13)28(23(20)37)45-30-26(40)24(38)25(39)29(41)46-30/h2-9,15,20-21,23-35,37-41H,10-12H2,1H3 |
InChI Key | SKWZAUHMKBQODM-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C30H38O16 |
Molecular Weight | 654.60 g/mol |
Exact Mass | 654.21598512 g/mol |
Topological Polar Surface Area (TPSA) | 266.00 Ų |
XlogP | -1.40 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.80% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.96% | 96.09% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 97.73% | 91.49% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 96.18% | 96.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.23% | 89.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.92% | 94.45% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.80% | 86.33% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.47% | 99.17% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.47% | 97.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.78% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 89.52% | 98.95% |
CHEMBL4208 | P20618 | Proteasome component C5 | 88.19% | 90.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 86.04% | 85.14% |
CHEMBL3401 | O75469 | Pregnane X receptor | 85.85% | 94.73% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 83.24% | 91.19% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 82.18% | 86.92% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.18% | 95.89% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 81.06% | 95.50% |
CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 80.99% | 94.23% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 80.88% | 91.03% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.87% | 92.62% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 80.87% | 94.08% |
CHEMBL3194 | P02766 | Transthyretin | 80.41% | 90.71% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 80.36% | 94.80% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Campsis grandiflora |
Deplanchea speciosa |
Fraxinus americana |
Paulownia tomentosa |
Sesamum indicum |
Stachys byzantina |
PubChem | 163067979 |
LOTUS | LTS0168967 |
wikiData | Q104399822 |