(2E)-8-hydroxy-2-(8-hydroxy-4-methoxy-6-methyl-1-oxonaphthalen-2-ylidene)-4-methoxy-6-methylnaphthalen-1-one
| Internal ID | afbf6dab-4310-4b0e-904e-103d40e5bfd6 |
| Taxonomy | Benzenoids > Naphthalenes |
| IUPAC Name | (2E)-8-hydroxy-2-(8-hydroxy-4-methoxy-6-methyl-1-oxonaphthalen-2-ylidene)-4-methoxy-6-methylnaphthalen-1-one |
| SMILES (Canonical) | CC1=CC2=C(C(=C1)O)C(=O)C(=C3C=C(C4=C(C3=O)C(=CC(=C4)C)O)OC)C=C2OC |
| SMILES (Isomeric) | CC1=CC2=C(C(=C1)O)C(=O)/C(=C/3\C=C(C4=C(C3=O)C(=CC(=C4)C)O)OC)/C=C2OC |
| InChI | InChI=1S/C24H20O6/c1-11-5-15-19(29-3)9-13(23(27)21(15)17(25)7-11)14-10-20(30-4)16-6-12(2)8-18(26)22(16)24(14)28/h5-10,25-26H,1-4H3/b14-13+ |
| InChI Key | WIZRPQYWANTMOT-BUHFOSPRSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C24H20O6 |
| Molecular Weight | 404.40 g/mol |
| Exact Mass | 404.12598835 g/mol |
| Topological Polar Surface Area (TPSA) | 93.10 Ų |
| XlogP | 4.90 |
| SCHEMBL18537838 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.81% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.57% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.53% | 98.95% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 92.52% | 91.49% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 88.13% | 90.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.92% | 99.23% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 86.24% | 96.95% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.79% | 86.33% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.71% | 94.00% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 83.70% | 97.21% |
| CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 83.55% | 92.68% |
| CHEMBL2535 | P11166 | Glucose transporter | 82.88% | 98.75% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 82.66% | 93.03% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.39% | 89.00% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 81.12% | 99.15% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| PubChem | 15082476 |
| LOTUS | LTS0248573 |
| wikiData | Q104397555 |