(-)-Stephanine; (R)-(-)-Stephanine; 8-Methoxy-1,2-(methylenedioxy)-6abeta-aporphine; Stephanin; l-Stephanine
Internal ID | 44e8fc90-dab9-4d37-bea9-d3d3e240f7f5 |
Taxonomy | Alkaloids and derivatives > Aporphines |
IUPAC Name | 15-methoxy-11-methyl-3,5-dioxa-11-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1(20),2(6),7,14(19),15,17-hexaene |
SMILES (Canonical) | CN1CCC2=CC3=C(C4=C2C1CC5=C4C=CC=C5OC)OCO3 |
SMILES (Isomeric) | CN1CCC2=CC3=C(C4=C2C1CC5=C4C=CC=C5OC)OCO3 |
InChI | InChI=1S/C19H19NO3/c1-20-7-6-11-8-16-19(23-10-22-16)18-12-4-3-5-15(21-2)13(12)9-14(20)17(11)18/h3-5,8,14H,6-7,9-10H2,1-2H3 |
InChI Key | UEAPAHNNFSZHMW-UHFFFAOYSA-N |
Popularity | 4 references in papers |
Molecular Formula | C19H19NO3 |
Molecular Weight | 309.40 g/mol |
Exact Mass | 309.13649347 g/mol |
Topological Polar Surface Area (TPSA) | 30.90 Ų |
XlogP | 3.30 |
Atomic LogP (AlogP) | 3.18 |
H-Bond Acceptor | 4 |
H-Bond Donor | 0 |
Rotatable Bonds | 1 |
1,2-methylenedioxy-8-methoxyaporphine |
(12R)-15-methoxy-11-methyl-3,5-dioxa-11-azapentacyclo[10.7.1.0^{2,6.0^{8,20.0^{14,19]icosa-1(20),2(6),7,14(19),15,17-hexaene |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.9699 | 96.99% |
Caco-2 | + | 0.9601 | 96.01% |
Blood Brain Barrier | + | 0.8750 | 87.50% |
Human oral bioavailability | - | 0.7286 | 72.86% |
Subcellular localzation | Lysosomes | 0.5786 | 57.86% |
OATP2B1 inhibitior | - | 1.0000 | 100.00% |
OATP1B1 inhibitior | + | 0.9383 | 93.83% |
OATP1B3 inhibitior | + | 0.9490 | 94.90% |
MATE1 inhibitior | - | 0.9000 | 90.00% |
OCT2 inhibitior | - | 0.5000 | 50.00% |
BSEP inhibitior | + | 0.7444 | 74.44% |
P-glycoprotein inhibitior | - | 0.8148 | 81.48% |
P-glycoprotein substrate | - | 0.5464 | 54.64% |
CYP3A4 substrate | + | 0.6465 | 64.65% |
CYP2C9 substrate | - | 0.6129 | 61.29% |
CYP2D6 substrate | + | 0.7342 | 73.42% |
CYP3A4 inhibition | - | 0.6163 | 61.63% |
CYP2C9 inhibition | - | 0.9398 | 93.98% |
CYP2C19 inhibition | - | 0.7280 | 72.80% |
CYP2D6 inhibition | + | 0.9165 | 91.65% |
CYP1A2 inhibition | + | 0.7908 | 79.08% |
CYP2C8 inhibition | - | 0.7392 | 73.92% |
CYP inhibitory promiscuity | + | 0.5072 | 50.72% |
UGT catelyzed | - | 0.0000 | 0.00% |
Carcinogenicity (binary) | - | 0.9800 | 98.00% |
Carcinogenicity (trinary) | Non-required | 0.6345 | 63.45% |
Eye corrosion | - | 0.9897 | 98.97% |
Eye irritation | - | 0.9822 | 98.22% |
Skin irritation | - | 0.7922 | 79.22% |
Skin corrosion | - | 0.9394 | 93.94% |
Ames mutagenesis | + | 0.8600 | 86.00% |
Human Ether-a-go-go-Related Gene inhibition | + | 0.8180 | 81.80% |
Micronuclear | - | 0.6000 | 60.00% |
Hepatotoxicity | - | 0.8250 | 82.50% |
skin sensitisation | - | 0.8553 | 85.53% |
Respiratory toxicity | + | 0.9222 | 92.22% |
Reproductive toxicity | + | 0.8667 | 86.67% |
Mitochondrial toxicity | + | 0.9000 | 90.00% |
Nephrotoxicity | - | 0.6314 | 63.14% |
Acute Oral Toxicity (c) | III | 0.6062 | 60.62% |
Estrogen receptor binding | + | 0.5406 | 54.06% |
Androgen receptor binding | + | 0.5739 | 57.39% |
Thyroid receptor binding | - | 0.4936 | 49.36% |
Glucocorticoid receptor binding | + | 0.8449 | 84.49% |
Aromatase binding | - | 0.7405 | 74.05% |
PPAR gamma | + | 0.7191 | 71.91% |
Honey bee toxicity | - | 0.7914 | 79.14% |
Biodegradation | - | 0.9250 | 92.50% |
Crustacea aquatic toxicity | + | 0.6900 | 69.00% |
Fish aquatic toxicity | + | 0.9024 | 90.24% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.89% | 96.09% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 98.45% | 96.77% |
CHEMBL2581 | P07339 | Cathepsin D | 96.44% | 98.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.07% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.86% | 86.33% |
CHEMBL2056 | P21728 | Dopamine D1 receptor | 93.54% | 91.00% |
CHEMBL2535 | P11166 | Glucose transporter | 92.65% | 98.75% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 92.43% | 93.40% |
CHEMBL4247 | Q9UM73 | ALK tyrosine kinase receptor | 91.45% | 96.86% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 90.41% | 95.89% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 89.77% | 91.11% |
CHEMBL240 | Q12809 | HERG | 88.10% | 89.76% |
CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 87.18% | 94.03% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 87.16% | 92.62% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 86.98% | 95.78% |
CHEMBL2146302 | O94925 | Glutaminase kidney isoform, mitochondrial | 86.25% | 100.00% |
CHEMBL5311 | P37023 | Serine/threonine-protein kinase receptor R3 | 86.12% | 82.67% |
CHEMBL5747 | Q92793 | CREB-binding protein | 85.96% | 95.12% |
CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 85.92% | 96.00% |
CHEMBL5203 | P33316 | dUTP pyrophosphatase | 85.76% | 99.18% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 85.60% | 89.62% |
CHEMBL4895 | P30530 | Tyrosine-protein kinase receptor UFO | 85.43% | 90.95% |
CHEMBL217 | P14416 | Dopamine D2 receptor | 85.39% | 95.62% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 84.35% | 97.14% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 84.16% | 93.99% |
CHEMBL261 | P00915 | Carbonic anhydrase I | 83.08% | 96.76% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 83.03% | 89.50% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.79% | 89.00% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 82.75% | 100.00% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 82.44% | 91.49% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.24% | 94.00% |
CHEMBL5406 | Q86X55 | Histone-arginine methyltransferase CARM1 | 82.11% | 94.33% |
CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 81.74% | 82.38% |
CHEMBL5925 | P22413 | Ectonucleotide pyrophosphatase/phosphodiesterase family member 1 | 81.32% | 92.38% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.92% | 100.00% |
CHEMBL4355 | O14976 | Serine/threonine-protein kinase GAK | 80.75% | 89.32% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Magnolia coco |
Stemona tuberosa |
Stephania bancroftii |
Stephania delavayi |
Stephania japonica |
Stephania venosa |
PubChem | 10335495 |
NPASS | NPC148597 |
LOTUS | LTS0104341 |
wikiData | Q105270735 |