(3Z)-3-(3-oxo-1H-indol-2-ylidene)-1H-indol-2-one
Internal ID | cbaa3447-a6b7-4194-a0a4-9863a353b1dc |
Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Indolines |
IUPAC Name | (3Z)-3-(3-oxo-1H-indol-2-ylidene)-1H-indol-2-one |
SMILES (Canonical) | C1=CC=C2C(=C1)C(=C3C(=O)C4=CC=CC=C4N3)C(=O)N2 |
SMILES (Isomeric) | C1=CC=C2C(=C1)/C(=C/3\C(=O)C4=CC=CC=C4N3)/C(=O)N2 |
InChI | InChI=1S/C16H10N2O2/c19-15-10-6-2-4-8-12(10)17-14(15)13-9-5-1-3-7-11(9)18-16(13)20/h1-8,17H,(H,18,20)/b14-13- |
InChI Key | CRDNMYFJWFXOCH-YPKPFQOOSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C16H10N2O2 |
Molecular Weight | 262.26 g/mol |
Exact Mass | 262.074227566 g/mol |
Topological Polar Surface Area (TPSA) | 58.20 Ų |
XlogP | 2.30 |
Atomic LogP (AlogP) | 2.66 |
H-Bond Acceptor | 3 |
H-Bond Donor | 2 |
Rotatable Bonds | 0 |
There are no found synonyms. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.9958 | 99.58% |
Caco-2 | + | 0.7622 | 76.22% |
Blood Brain Barrier | + | 0.7379 | 73.79% |
Human oral bioavailability | + | 0.8714 | 87.14% |
Subcellular localzation | Plasma membrane | 0.5536 | 55.36% |
OATP2B1 inhibitior | - | 1.0000 | 100.00% |
OATP1B1 inhibitior | + | 0.9443 | 94.43% |
OATP1B3 inhibitior | + | 0.9361 | 93.61% |
MATE1 inhibitior | - | 0.9400 | 94.00% |
OCT2 inhibitior | - | 0.9250 | 92.50% |
BSEP inhibitior | + | 0.6521 | 65.21% |
P-glycoprotein inhibitior | - | 0.8857 | 88.57% |
P-glycoprotein substrate | - | 0.9438 | 94.38% |
CYP3A4 substrate | - | 0.5588 | 55.88% |
CYP2C9 substrate | - | 0.8038 | 80.38% |
CYP2D6 substrate | - | 0.8482 | 84.82% |
CYP3A4 inhibition | - | 0.7701 | 77.01% |
CYP2C9 inhibition | + | 0.7922 | 79.22% |
CYP2C19 inhibition | + | 0.7526 | 75.26% |
CYP2D6 inhibition | - | 0.6903 | 69.03% |
CYP1A2 inhibition | + | 0.8837 | 88.37% |
CYP2C8 inhibition | - | 0.9532 | 95.32% |
CYP inhibitory promiscuity | + | 0.9517 | 95.17% |
UGT catelyzed | - | 0.0000 | 0.00% |
Carcinogenicity (binary) | - | 0.8643 | 86.43% |
Carcinogenicity (trinary) | Non-required | 0.4943 | 49.43% |
Eye corrosion | - | 0.9896 | 98.96% |
Eye irritation | + | 0.7760 | 77.60% |
Skin irritation | - | 0.8398 | 83.98% |
Skin corrosion | - | 0.9622 | 96.22% |
Ames mutagenesis | + | 0.6700 | 67.00% |
Human Ether-a-go-go-Related Gene inhibition | - | 0.7080 | 70.80% |
Micronuclear | + | 0.9400 | 94.00% |
Hepatotoxicity | + | 0.8125 | 81.25% |
skin sensitisation | - | 0.9176 | 91.76% |
Respiratory toxicity | - | 0.5444 | 54.44% |
Reproductive toxicity | + | 0.5778 | 57.78% |
Mitochondrial toxicity | + | 0.5500 | 55.00% |
Nephrotoxicity | + | 0.7890 | 78.90% |
Acute Oral Toxicity (c) | III | 0.5903 | 59.03% |
Estrogen receptor binding | + | 0.8465 | 84.65% |
Androgen receptor binding | + | 0.8689 | 86.89% |
Thyroid receptor binding | + | 0.5666 | 56.66% |
Glucocorticoid receptor binding | + | 0.8459 | 84.59% |
Aromatase binding | + | 0.8674 | 86.74% |
PPAR gamma | + | 0.6449 | 64.49% |
Honey bee toxicity | - | 0.7865 | 78.65% |
Biodegradation | - | 0.9750 | 97.50% |
Crustacea aquatic toxicity | + | 0.6100 | 61.00% |
Fish aquatic toxicity | + | 0.8819 | 88.19% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL308 | P06493 | Cyclin-dependent kinase 1 |
10000 nM |
IC50 |
PMID: 20810192
|
CHEMBL301 | P24941 | Cyclin-dependent kinase 2 |
2200 nM |
IC50 |
PMID: 12672248
|
CHEMBL262 | P49841 | Glycogen synthase kinase-3 beta |
4 nM 4 nM |
IC50 IC50 |
PMID: 26562543
via Super-PRED |
CHEMBL4040 | P28482 | MAP kinase ERK2 |
31622.8 nM |
Potency |
via CMAUP
|
CHEMBL1293224 | P10636 | Microtubule-associated protein tau |
89.1 nM 251.2 nM 100 nM 89.1 nM 141.3 nM 199.5 nM |
Potency Potency Potency Potency Potency Potency |
via Super-PRED
via CMAUP via CMAUP via CMAUP via CMAUP via CMAUP |
CHEMBL1293294 | P51151 | Ras-related protein Rab-9A |
5623.4 nM |
Potency |
via CMAUP
|
CHEMBL1293232 | Q16637 | Survival motor neuron protein |
19952.6 nM |
Potency |
via CMAUP
|
CHEMBL267 | P12931 | Tyrosine-protein kinase SRC |
18000 nM |
IC50 |
PMID: 12672248
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.26% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 93.27% | 98.95% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 89.53% | 82.69% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 88.80% | 93.03% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 87.42% | 92.88% |
CHEMBL2850 | P49840 | Glycogen synthase kinase-3 alpha | 87.41% | 88.84% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 87.02% | 94.75% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 87.00% | 94.62% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 86.83% | 91.11% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 85.45% | 94.08% |
CHEMBL299 | P17252 | Protein kinase C alpha | 84.69% | 98.03% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.15% | 99.23% |
CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 82.01% | 96.67% |
CHEMBL4237 | O75582 | Ribosomal protein S6 kinase alpha 5 | 81.18% | 91.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Allium macrostemon |
Calanthe discolor |
Crotalaria paniculata |
Geijera parviflora |
Indigofera suffruticosa |
Isatis tinctoria |
Persicaria tinctoria |
Spiraea japonica |
Wrightia tinctoria |
PubChem | 5318433 |
NPASS | NPC300596 |
ChEMBL | CHEMBL1276127 |
LOTUS | LTS0039100 |
wikiData | Q104968482 |