3,8'-Biapigenin
| Internal ID | cd8a3218-bd1e-42e1-baa8-3a33525fa99a |
| Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Biflavonoids and polyflavonoids |
| IUPAC Name | 3-[5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxochromen-8-yl]-5,7-dihydroxy-2-(4-hydroxyphenyl)chromen-4-one |
| SMILES (Canonical) | C1=CC(=CC=C1C2=CC(=O)C3=C(O2)C(=C(C=C3O)O)C4=C(OC5=CC(=CC(=C5C4=O)O)O)C6=CC=C(C=C6)O)O |
| SMILES (Isomeric) | C1=CC(=CC=C1C2=CC(=O)C3=C(O2)C(=C(C=C3O)O)C4=C(OC5=CC(=CC(=C5C4=O)O)O)C6=CC=C(C=C6)O)O |
| InChI | InChI=1S/C30H18O10/c31-15-5-1-13(2-6-15)22-12-21(37)24-19(35)11-20(36)26(30(24)39-22)27-28(38)25-18(34)9-17(33)10-23(25)40-29(27)14-3-7-16(32)8-4-14/h1-12,31-36H |
| InChI Key | IQAMTZLKUHMPPE-UHFFFAOYSA-N |
| Popularity | 22 references in papers |
| Molecular Formula | C30H18O10 |
| Molecular Weight | 538.50 g/mol |
| Exact Mass | 538.08999677 g/mol |
| Topological Polar Surface Area (TPSA) | 174.00 Ų |
| XlogP | 5.00 |
| Atomic LogP (AlogP) | 5.13 |
| H-Bond Acceptor | 10 |
| H-Bond Donor | 6 |
| Rotatable Bonds | 3 |
| 101140-06-1 |
| 3,8''-biapigenin |
| biapigenin |
| 13,Ii8-Biapigenin |
| CHEMBL515252 |
| Biapigenin; I3,II8-Biapigenin |
| 3-[5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxochromen-8-yl]-5,7-dihydroxy-2-(4-hydroxyphenyl)chromen-4-one |
| 4',4''',5,5'',7,7''-Hexahydroxy-3,8''-biflavone |
| 5,5',7,7'-Tetrahydroxy-2,2'-bis(4-hydroxyphenyl)-4H,4'H-[3,8'-bichromene]-4,4'-dione |
| 3,8''''-biapigenin |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.9336 | 93.36% |
| Caco-2 | - | 0.8536 | 85.36% |
| Blood Brain Barrier | - | 0.8250 | 82.50% |
| Human oral bioavailability | - | 0.8000 | 80.00% |
| Subcellular localzation | Mitochondria | 0.8010 | 80.10% |
| OATP2B1 inhibitior | + | 0.5762 | 57.62% |
| OATP1B1 inhibitior | + | 0.7502 | 75.02% |
| OATP1B3 inhibitior | - | 0.2208 | 22.08% |
| MATE1 inhibitior | + | 0.6600 | 66.00% |
| OCT2 inhibitior | - | 0.9500 | 95.00% |
| BSEP inhibitior | - | 0.4701 | 47.01% |
| P-glycoprotein inhibitior | - | 0.5478 | 54.78% |
| P-glycoprotein substrate | - | 0.6613 | 66.13% |
| CYP3A4 substrate | + | 0.6125 | 61.25% |
| CYP2C9 substrate | - | 0.6443 | 64.43% |
| CYP2D6 substrate | - | 0.8503 | 85.03% |
| CYP3A4 inhibition | + | 0.6172 | 61.72% |
| CYP2C9 inhibition | + | 0.8920 | 89.20% |
| CYP2C19 inhibition | + | 0.6827 | 68.27% |
| CYP2D6 inhibition | - | 0.9322 | 93.22% |
| CYP1A2 inhibition | + | 0.6838 | 68.38% |
| CYP2C8 inhibition | + | 0.9135 | 91.35% |
| CYP inhibitory promiscuity | + | 0.5157 | 51.57% |
| UGT catelyzed | + | 0.7000 | 70.00% |
| Carcinogenicity (binary) | - | 0.9600 | 96.00% |
| Carcinogenicity (trinary) | Non-required | 0.7320 | 73.20% |
| Eye corrosion | - | 0.9929 | 99.29% |
| Eye irritation | + | 0.5457 | 54.57% |
| Skin irritation | + | 0.5256 | 52.56% |
| Skin corrosion | - | 0.9525 | 95.25% |
| Ames mutagenesis | + | 0.6200 | 62.00% |
| Human Ether-a-go-go-Related Gene inhibition | - | 0.3778 | 37.78% |
| Micronuclear | + | 0.9200 | 92.00% |
| Hepatotoxicity | + | 0.5375 | 53.75% |
| skin sensitisation | - | 0.8881 | 88.81% |
| Respiratory toxicity | + | 0.6778 | 67.78% |
| Reproductive toxicity | + | 0.7000 | 70.00% |
| Mitochondrial toxicity | + | 0.5625 | 56.25% |
| Nephrotoxicity | - | 0.6616 | 66.16% |
| Acute Oral Toxicity (c) | II | 0.6295 | 62.95% |
| Estrogen receptor binding | + | 0.8726 | 87.26% |
| Androgen receptor binding | + | 0.9450 | 94.50% |
| Thyroid receptor binding | + | 0.5997 | 59.97% |
| Glucocorticoid receptor binding | + | 0.8026 | 80.26% |
| Aromatase binding | + | 0.5750 | 57.50% |
| PPAR gamma | + | 0.8371 | 83.71% |
| Honey bee toxicity | - | 0.7983 | 79.83% |
| Biodegradation | - | 0.9500 | 95.00% |
| Crustacea aquatic toxicity | - | 0.6100 | 61.00% |
| Fish aquatic toxicity | + | 0.9283 | 92.83% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| CHEMBL1293236 | P46063 | ATP-dependent DNA helicase Q1 |
12589.3 nM |
Potency |
via CMAUP
|
| CHEMBL1293237 | P54132 | Bloom syndrome protein |
12589.3 nM |
Potency |
via CMAUP
|
| CHEMBL340 | P08684 | Cytochrome P450 3A4 |
80 nM |
IC50 |
PMID: 20408551
|
| CHEMBL2392 | P06746 | DNA polymerase beta |
3162.3 nM |
Potency |
via CMAUP
|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase |
1995.3 nM |
Potency |
via CMAUP
|
| CHEMBL4361 | Q07820 | Induced myeloid leukemia cell differentiation protein Mcl-1 |
2725.54 nM |
IC50 |
via CMAUP
|
| CHEMBL1293226 | B2RXH2 | Lysine-specific demethylase 4D-like |
35481.3 nM |
Potency |
via CMAUP
|
| CHEMBL1293224 | P10636 | Microtubule-associated protein tau |
15848.9 nM 15848.9 nM |
Potency Potency |
via CMAUP
via CMAUP |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B |
4500 nM |
IC50 |
PMID: 25907369
|
| CHEMBL1075189 | P14618 | Pyruvate kinase isozymes M1/M2 |
7943.3 nM 7943.3 nM |
Potency Potency |
via CMAUP
via CMAUP |
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL242 | Q92731 | Estrogen receptor beta | 98.63% | 98.35% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.88% | 91.11% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 96.15% | 89.00% |
| CHEMBL3194 | P02766 | Transthyretin | 95.45% | 90.71% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.22% | 98.95% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.27% | 94.00% |
| CHEMBL3038469 | P24941 | CDK2/Cyclin A | 91.72% | 91.38% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 91.23% | 99.15% |
| CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 90.58% | 95.64% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.20% | 94.45% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 89.02% | 94.73% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.31% | 95.56% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 85.66% | 90.71% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 85.57% | 96.21% |
| CHEMBL5284 | Q96RR4 | CaM-kinase kinase beta | 85.55% | 89.23% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.74% | 86.33% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.00% | 99.23% |
| CHEMBL308 | P06493 | Cyclin-dependent kinase 1 | 82.97% | 91.73% |
| CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 82.74% | 85.11% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 82.52% | 91.49% |
| CHEMBL5408 | Q9UHD2 | Serine/threonine-protein kinase TBK1 | 81.11% | 90.48% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 80.68% | 91.71% |
| CHEMBL4530 | P00488 | Coagulation factor XIII | 80.17% | 96.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Fagopyrum esculentum |
| Garcinia xanthochymus |
| Hypericum perforatum |
| Hypericum scabrum |
| Hypericum thasium |
| PubChem | 10414856 |
| NPASS | NPC288840 |
| ChEMBL | CHEMBL515252 |
| LOTUS | LTS0048872 |
| wikiData | Q105117624 |