3-methoxy-5-hydroxyphenol-1-O-beta-d-glucopyranoside
Internal ID | 92162cfe-ca4f-4a3e-b213-669da173f327 |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Glycosyl compounds > Phenolic glycosides |
IUPAC Name | (2S,3R,4S,5S,6R)-2-(3-hydroxy-5-methoxyphenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol |
SMILES (Canonical) | COC1=CC(=CC(=C1)O)OC2C(C(C(C(O2)CO)O)O)O |
SMILES (Isomeric) | COC1=CC(=CC(=C1)O)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O |
InChI | InChI=1S/C13H18O8/c1-19-7-2-6(15)3-8(4-7)20-13-12(18)11(17)10(16)9(5-14)21-13/h2-4,9-18H,5H2,1H3/t9-,10-,11+,12-,13-/m1/s1 |
InChI Key | SJBWDSQCMPAGHA-UJPOAAIJSA-N |
Popularity | 7 references in papers |
Molecular Formula | C13H18O8 |
Molecular Weight | 302.28 g/mol |
Exact Mass | 302.10016753 g/mol |
Topological Polar Surface Area (TPSA) | 129.00 Ų |
XlogP | -0.90 |
(2S,3R,4S,5S,6R)-2-(3-Hydroxy-5-methoxyphenoxy)-6-(hydroxymethyl)tetrahydro-2H-pyran-3,4,5-triol |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.67% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.28% | 96.09% |
CHEMBL3401 | O75469 | Pregnane X receptor | 89.61% | 94.73% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.79% | 99.17% |
CHEMBL2581 | P07339 | Cathepsin D | 86.66% | 98.95% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 86.52% | 95.93% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.35% | 94.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 84.40% | 95.89% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 84.32% | 86.92% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 83.29% | 97.36% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.10% | 86.33% |
CHEMBL4208 | P20618 | Proteasome component C5 | 82.95% | 90.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.49% | 97.09% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.32% | 95.89% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.61% | 95.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Bursera simaruba |
Dryopteris crassirhizoma |
Eriogonum brevicaule |
Picrasma quassioides |
Sedum crassularia |
PubChem | 91378659 |
LOTUS | LTS0124961 |
wikiData | Q105254185 |