3-Acetyl-4abeta,5beta-dimethyl-1,2,4a,5,6,7,8,8abeta-octahydronaphthalene-2-one
Internal ID | 4dda8ad8-7b27-456c-8102-2e3e140ebbc2 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids > Eremophilane, 8,9-secoeremophilane and furoeremophilane sesquiterpenoids |
IUPAC Name | (4aR,5S,8aR)-3-acetyl-4a,5-dimethyl-1,5,6,7,8,8a-hexahydronaphthalen-2-one |
SMILES (Canonical) | CC1CCCC2C1(C=C(C(=O)C2)C(=O)C)C |
SMILES (Isomeric) | C[C@H]1CCC[C@H]2[C@@]1(C=C(C(=O)C2)C(=O)C)C |
InChI | InChI=1S/C14H20O2/c1-9-5-4-6-11-7-13(16)12(10(2)15)8-14(9,11)3/h8-9,11H,4-7H2,1-3H3/t9-,11+,14+/m0/s1 |
InChI Key | XNORMQKITMTNGH-DRCTWCGVSA-N |
Popularity | 0 references in papers |
Molecular Formula | C14H20O2 |
Molecular Weight | 220.31 g/mol |
Exact Mass | 220.146329876 g/mol |
Topological Polar Surface Area (TPSA) | 34.10 Ų |
XlogP | 3.20 |
(4aR,5S,8aR)-3-Acetyl-4a,5,6,7,8,8a-hexahydro-4a,5-dimethyl-2(1H)-naphthalenone |
3-Acetyl-4abeta,5beta-dimethyl-1,2,4a,5,6,7,8,8abeta-octahydronaphthalene-2-one |
348119-85-7 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.75% | 96.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 90.48% | 97.25% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.33% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 90.13% | 98.95% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 89.14% | 93.04% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 87.81% | 82.69% |
CHEMBL1902 | P62942 | FK506-binding protein 1A | 86.61% | 97.05% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.11% | 97.09% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.01% | 91.19% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.01% | 95.56% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.00% | 94.45% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.97% | 100.00% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 81.51% | 92.94% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 81.18% | 93.03% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 10846585 |
NPASS | NPC135468 |
LOTUS | LTS0075302 |
wikiData | Q105331855 |