3-(3,4,5-Trimethoxyphenyl)-2-propen-1-ol
Internal ID | fd8a0d8e-1772-4ec9-91a6-81e7f45b278e |
Taxonomy | Phenylpropanoids and polyketides > Cinnamyl alcohols |
IUPAC Name | 3-(3,4,5-trimethoxyphenyl)prop-2-en-1-ol |
SMILES (Canonical) | COC1=CC(=CC(=C1OC)OC)C=CCO |
SMILES (Isomeric) | COC1=CC(=CC(=C1OC)OC)C=CCO |
InChI | InChI=1S/C12H16O4/c1-14-10-7-9(5-4-6-13)8-11(15-2)12(10)16-3/h4-5,7-8,13H,6H2,1-3H3 |
InChI Key | HZDDMDAKGIRCPP-UHFFFAOYSA-N |
Popularity | 7 references in papers |
Molecular Formula | C12H16O4 |
Molecular Weight | 224.25 g/mol |
Exact Mass | 224.10485899 g/mol |
Topological Polar Surface Area (TPSA) | 47.90 Ų |
XlogP | 1.20 |
3',4',5'-Trimethoxycinnamyl alcohol |
trans-3,4-5-Trimethoxycinnamyl alcohol |
trans-3-(3,4,5-Trimethoxyphenyl)allyl alcohol |
HZDDMDAKGIRCPP-UHFFFAOYSA-N |
DTXSID001294937 |
AKOS017341547 |
3-(3,4,5-Trimethoxyphenyl) -2-propen-1-ol |
3-(3',4',5'-trimethoxyphenyl) prop-2-en-1-ol |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 94.88% | 96.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.25% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.30% | 91.11% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.20% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.24% | 95.56% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.49% | 99.17% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 81.45% | 86.92% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Boronia pinnata |
Croton lechleri |
Dracaena draco |
Juniperus thurifera |
Litsea cubeba |
Macrosolen globosus |
Myristica fragrans |
Zanthoxylum nitidum |
PubChem | 73924 |
LOTUS | LTS0071419 |
wikiData | Q104168539 |