[(2R,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxy-4-quinolinyl)methanol
Internal ID | 2bd51662-bf02-4222-9f21-5e1fa933db73 |
Taxonomy | Alkaloids and derivatives > Cinchona alkaloids |
IUPAC Name | [(2R,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol |
SMILES (Canonical) | COC1=CC2=C(C=CN=C2C=C1)C(C3CC4CCN3CC4C=C)O |
SMILES (Isomeric) | COC1=CC2=C(C=CN=C2C=C1)C([C@H]3CC4CCN3C[C@@H]4C=C)O |
InChI | InChI=1S/C20H24N2O2/c1-3-13-12-22-9-7-14(13)10-19(22)20(23)16-6-8-21-18-5-4-15(24-2)11-17(16)18/h3-6,8,11,13-14,19-20,23H,1,7,9-10,12H2,2H3/t13-,14?,19+,20?/m0/s1 |
InChI Key | LOUPRKONTZGTKE-BEFZOFJQSA-N |
Popularity | 7 references in papers |
Molecular Formula | C20H24N2O2 |
Molecular Weight | 324.40 g/mol |
Exact Mass | 324.183778013 g/mol |
Topological Polar Surface Area (TPSA) | 45.60 Ų |
XlogP | 2.90 |
SCHEMBL13587302 |
CHEBI:95172 |
HMS1791J09 |
NCGC00015871-04 |
NCGC00015871-05 |
NCGC00015871-06 |
NCGC00015871-08 |
NCGC00015871-09 |
NCGC00163147-04 |
NCGC00163147-05 |
There are more than 10 synonyms. If you wish to see them all click here. |
![2D Structure of [(2R,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxy-4-quinolinyl)methanol 2D Structure of [(2R,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxy-4-quinolinyl)methanol](https://plantaedb.com/storage/docs/compounds/2023/11/2r5r-5-ethenyl-1-azabicyclo222octan-2-yl-6-methoxy-4-quinolinylmethanol.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL289 | P10635 | Cytochrome P450 2D6 |
9 nM |
IC50 |
via Super-PRED
|
CHEMBL240 | Q12809 | HERG |
323.59 nM |
IC50 |
via Super-PRED
|
CHEMBL1947 | P10828 | Thyroid hormone receptor beta-1 |
63.1 nM |
Potency |
via Super-PRED
|
CHEMBL1963 | P16473 | Thyroid stimulating hormone receptor |
100 nM |
Potency |
via Super-PRED
|
CHEMBL1075138 | Q9NUW8 | Tyrosyl-DNA phosphodiesterase 1 |
31.6 nM |
Potency |
via Super-PRED
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.23% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.23% | 91.11% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.88% | 85.14% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.53% | 94.45% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 93.26% | 95.89% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 92.18% | 91.49% |
CHEMBL2243 | O00519 | Anandamide amidohydrolase | 91.85% | 97.53% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 89.27% | 92.94% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 89.05% | 91.03% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.73% | 95.56% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 88.50% | 95.89% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.82% | 86.33% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 87.63% | 94.00% |
CHEMBL5747 | Q92793 | CREB-binding protein | 86.76% | 95.12% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 86.43% | 100.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.49% | 89.00% |
CHEMBL1868 | P17948 | Vascular endothelial growth factor receptor 1 | 84.99% | 96.47% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 84.61% | 96.00% |
CHEMBL5203 | P33316 | dUTP pyrophosphatase | 83.72% | 99.18% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.63% | 97.09% |
CHEMBL2581 | P07339 | Cathepsin D | 83.18% | 98.95% |
CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 83.04% | 98.33% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.82% | 92.62% |
CHEMBL6175 | Q9H3R0 | Lysine-specific demethylase 4C | 82.39% | 96.69% |
CHEMBL264 | Q9Y5N1 | Histamine H3 receptor | 81.71% | 91.43% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 81.42% | 95.83% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 81.28% | 89.62% |
CHEMBL4208 | P20618 | Proteasome component C5 | 81.25% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Aspidosperma excelsum |
Ciliosemina pedunculata |
Cinchona calisaya |
Cinchona officinalis |
Cinchona pubescens |
PubChem | 24867865 |
LOTUS | LTS0234139 |
wikiData | Q27166974 |