(2E,4E,8Z,10E,12E)-N-propan-2-yltetradeca-2,4,8,10,12-pentaenamide
| Internal ID | 045da637-c6e7-48e7-baad-76419bb42132 |
| Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty amides > N-acyl amines |
| IUPAC Name | (2E,4E,8Z,10E,12E)-N-propan-2-yltetradeca-2,4,8,10,12-pentaenamide |
| SMILES (Canonical) | CC=CC=CC=CCCC=CC=CC(=O)NC(C)C |
| SMILES (Isomeric) | C/C=C/C=C/C=C\CC/C=C/C=C/C(=O)NC(C)C |
| InChI | InChI=1S/C17H25NO/c1-4-5-6-7-8-9-10-11-12-13-14-15-17(19)18-16(2)3/h4-9,12-16H,10-11H2,1-3H3,(H,18,19)/b5-4+,7-6+,9-8-,13-12+,15-14+ |
| InChI Key | PSKIOIDCXFHNJA-JDXPBYPHSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C17H25NO |
| Molecular Weight | 259.40 g/mol |
| Exact Mass | 259.193614421 g/mol |
| Topological Polar Surface Area (TPSA) | 29.10 Ų |
| XlogP | 4.30 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 97.56% | 83.82% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 89.89% | 89.34% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.30% | 98.95% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 88.59% | 100.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.84% | 96.09% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.77% | 99.17% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 82.26% | 94.33% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 81.97% | 94.73% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 81.69% | 96.47% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 81.55% | 93.56% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 80.90% | 89.50% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 80.64% | 98.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Zanthoxylum ailanthoides |
| Zanthoxylum bungeanum |
| Zanthoxylum gilletii |
| Zanthoxylum integrifoliolum |
| Zanthoxylum zanthoxyloides |
| PubChem | 5321102 |
| LOTUS | LTS0210587 |
| wikiData | Q105214223 |