2,2,6a,6a,8a,9,14a-heptamethyl-10-oxo-3,4,5,6,6b,7,8,9,11,12,12a,13,14,14b-tetradecahydro-1H-picene-4a-carbaldehyde
Internal ID | 48bfdb95-2bb0-47d3-8740-157c06e1c749 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | 2,2,6a,6a,8a,9,14a-heptamethyl-10-oxo-3,4,5,6,6b,7,8,9,11,12,12a,13,14,14b-tetradecahydro-1H-picene-4a-carbaldehyde |
SMILES (Canonical) | CC1C(=O)CCC2C1(CCC3C2(CCC4(C3(CCC5(C4CC(CC5)(C)C)C=O)C)C)C)C |
SMILES (Isomeric) | CC1C(=O)CCC2C1(CCC3C2(CCC4(C3(CCC5(C4CC(CC5)(C)C)C=O)C)C)C)C |
InChI | InChI=1S/C30H48O2/c1-20-21(32)8-9-22-26(20,4)11-10-23-27(22,5)13-14-29(7)24-18-25(2,3)12-16-30(24,19-31)17-15-28(23,29)6/h19-20,22-24H,8-18H2,1-7H3 |
InChI Key | ONRNCDHSZVITNY-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C30H48O2 |
Molecular Weight | 440.70 g/mol |
Exact Mass | 440.365430770 g/mol |
Topological Polar Surface Area (TPSA) | 34.10 Ų |
XlogP | 8.10 |
ONRNCDHSZVITNY-UHFFFAOYSA-N |
D:A-Friedooleanan-28-al, 3-oxo- |
2,2,6a,8a,9,12b,14a-Heptamethyl-10-oxoicosahydro-4a(2H)-picenecarbaldehyde # |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.65% | 95.56% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 91.95% | 100.00% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 91.85% | 82.69% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 88.37% | 94.75% |
CHEMBL2581 | P07339 | Cathepsin D | 88.33% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 88.25% | 91.11% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.12% | 97.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 85.26% | 97.25% |
CHEMBL1871 | P10275 | Androgen Receptor | 84.41% | 96.43% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 84.32% | 92.94% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.37% | 94.45% |
CHEMBL2664 | P23526 | Adenosylhomocysteinase | 82.63% | 86.67% |
CHEMBL1902 | P62942 | FK506-binding protein 1A | 82.41% | 97.05% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 80.67% | 96.77% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Calophyllum calaba |
Calophyllum inophyllum |
Calophyllum thwaitesii |
Elaeodendron transvaalense |
Euonymus revolutus |
Gymnosporia diversifolia |
Semialarium mexicanum |
Syzygium formosanum |
PubChem | 586214 |
LOTUS | LTS0074787 |
wikiData | Q105195080 |