24-Ethyllophenol
Internal ID | 9c99a682-da99-4bab-8a38-a411dcdaa204 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Stigmastanes and derivatives |
IUPAC Name | 17-(5-ethyl-6-methylheptan-2-yl)-4,10,13-trimethyl-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
SMILES (Canonical) | CCC(CCC(C)C1CCC2C1(CCC3C2=CCC4C3(CCC(C4C)O)C)C)C(C)C |
SMILES (Isomeric) | CCC(CCC(C)C1CCC2C1(CCC3C2=CCC4C3(CCC(C4C)O)C)C)C(C)C |
InChI | InChI=1S/C30H52O/c1-8-22(19(2)3)10-9-20(4)24-13-14-26-23-11-12-25-21(5)28(31)16-18-30(25,7)27(23)15-17-29(24,26)6/h11,19-22,24-28,31H,8-10,12-18H2,1-7H3 |
InChI Key | IYIFZADLIMVECH-UHFFFAOYSA-N |
Popularity | 4 references in papers |
Molecular Formula | C30H52O |
Molecular Weight | 428.70 g/mol |
Exact Mass | 428.401816278 g/mol |
Topological Polar Surface Area (TPSA) | 20.20 Ų |
XlogP | 9.50 |
14-(5-ethyl-6-methylheptan-2-yl)-2,6,15-trimethyltetracyclo[8.7.0.0^{2,7}.0^{11,15}]heptadec-9-en-5-ol |
Citrost-7-en-3-ol |
SCHEMBL10001889 |
4-Methylstigmast-7-en-3-ol # |
CHEBI:173034 |
IYIFZADLIMVECH-UHFFFAOYSA-N |
LMST01040242 |
17-(5-ethyl-6-methylheptan-2-yl)-4,10,13-trimethyl-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 98.36% | 97.25% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 96.55% | 90.17% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.90% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.54% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 93.00% | 98.95% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 89.10% | 82.69% |
CHEMBL1977 | P11473 | Vitamin D receptor | 89.08% | 99.43% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 88.42% | 93.56% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.73% | 94.45% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.51% | 97.09% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.39% | 95.89% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 86.83% | 90.71% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.57% | 100.00% |
CHEMBL3492 | P49721 | Proteasome Macropain subunit | 84.76% | 90.24% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.60% | 86.33% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 84.25% | 100.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 83.29% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Musa × paradisiaca |
Nigella sativa |
Olea europaea |
Solanum melongena |
Solanum virginianum |
PubChem | 541368 |
LOTUS | LTS0085508 |
wikiData | Q104253305 |