4-[2,3-dihydroxy-3-(2,3,14-trihydroxy-10,13-dimethyl-6-oxo-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl)butyl]-3,5-dimethyloxolan-2-one
Internal ID | 8cbdab57-e501-4383-b076-68d0beef3783 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | 4-[2,3-dihydroxy-3-(2,3,14-trihydroxy-10,13-dimethyl-6-oxo-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl)butyl]-3,5-dimethyloxolan-2-one |
SMILES (Canonical) | CC1C(C(OC1=O)C)CC(C(C)(C2CCC3(C2(CCC4C3=CC(=O)C5C4(CC(C(C5)O)O)C)C)O)O)O |
SMILES (Isomeric) | CC1C(C(OC1=O)C)CC(C(C)(C2CCC3(C2(CCC4C3=CC(=O)C5C4(CC(C(C5)O)O)C)C)O)O)O |
InChI | InChI=1S/C29H44O8/c1-14-16(15(2)37-25(14)34)10-24(33)28(5,35)23-7-9-29(36)18-11-20(30)19-12-21(31)22(32)13-26(19,3)17(18)6-8-27(23,29)4/h11,14-17,19,21-24,31-33,35-36H,6-10,12-13H2,1-5H3 |
InChI Key | NEFYSBQJYCICOG-UHFFFAOYSA-N |
Popularity | 14 references in papers |
Molecular Formula | C29H44O8 |
Molecular Weight | 520.70 g/mol |
Exact Mass | 520.30361836 g/mol |
Topological Polar Surface Area (TPSA) | 145.00 Ų |
XlogP | 1.00 |
4-[2,3-dihydroxy-3-(2,3,14-trihydroxy-10,13-dimethyl-6-oxo-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl)butyl]-3,5-dimethyloxolan-2-one |
LS-15270 |
FT-0686590 |
B0005-464561 |
(2|A,3|A,5|A,22R,24S,25S,28R)-2,3,14,20,22,28-Hexahydroxy-6-oxo-stigmast-7-en-26-oic acid |A-lactone |
![2D Structure of 4-[2,3-dihydroxy-3-(2,3,14-trihydroxy-10,13-dimethyl-6-oxo-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl)butyl]-3,5-dimethyloxolan-2-one 2D Structure of 4-[2,3-dihydroxy-3-(2,3,14-trihydroxy-10,13-dimethyl-6-oxo-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl)butyl]-3,5-dimethyloxolan-2-one](https://plantaedb.com/storage/docs/compounds/2023/11/238a1860-874e-11ee-9df3-f7b7e7377354.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 99.42% | 85.14% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 99.29% | 97.25% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.78% | 91.11% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.70% | 97.09% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 91.14% | 91.07% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.79% | 95.56% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 90.53% | 100.00% |
CHEMBL2581 | P07339 | Cathepsin D | 90.30% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.78% | 96.09% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 88.17% | 97.14% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.62% | 89.00% |
CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 86.48% | 94.78% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.83% | 95.89% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.75% | 86.33% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 83.03% | 82.69% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 82.74% | 96.77% |
CHEMBL1871 | P10275 | Androgen Receptor | 81.26% | 96.43% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 80.49% | 97.28% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.11% | 94.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ajuga chamaepitys |
Ajuga reptans |
Ajuga taiwanensis |
Cyathula capitata |
Cyathula officinalis |
PubChem | 554197 |
LOTUS | LTS0066224 |
wikiData | Q105177906 |