2',3,4,4'-tetrahydroxy Chalcone
| Internal ID | e4b0646a-cfc3-4174-a9e4-e0b5991a6eaa |
| Taxonomy | Phenylpropanoids and polyketides > Linear 1,3-diarylpropanoids > Chalcones and dihydrochalcones > 2-Hydroxychalcones |
| IUPAC Name | 1-(2,4-dihydroxyphenyl)-3-(3,4-dihydroxyphenyl)prop-2-en-1-one |
| SMILES (Canonical) | C1=CC(=C(C=C1C=CC(=O)C2=C(C=C(C=C2)O)O)O)O |
| SMILES (Isomeric) | C1=CC(=C(C=C1C=CC(=O)C2=C(C=C(C=C2)O)O)O)O |
| InChI | InChI=1S/C15H12O5/c16-10-3-4-11(14(19)8-10)12(17)5-1-9-2-6-13(18)15(20)7-9/h1-8,16,18-20H |
| InChI Key | AYMYWHCQALZEGT-UHFFFAOYSA-N |
| Popularity | 123 references in papers |
| Molecular Formula | C15H12O5 |
| Molecular Weight | 272.25 g/mol |
| Exact Mass | 272.06847348 g/mol |
| Topological Polar Surface Area (TPSA) | 98.00 Ų |
| XlogP | 2.80 |
| 21849-70-7 |
| MolMap_000005 |
| AYMYWHCQALZEGT-UHFFFAOYSA-N |
| DTXSID501305216 |
| HMS3653H04 |
| BCP31369 |
| NCI60_018489 |
| FT-0663936 |
| Q27164063 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.32% | 91.11% |
| CHEMBL3194 | P02766 | Transthyretin | 96.13% | 90.71% |
| CHEMBL1929 | P47989 | Xanthine dehydrogenase | 92.78% | 96.12% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.39% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.24% | 86.33% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 87.34% | 91.49% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 85.66% | 90.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.09% | 89.00% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 83.70% | 95.50% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 82.54% | 91.71% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 82.01% | 99.15% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 81.03% | 94.45% |
| CHEMBL2581 | P07339 | Cathepsin D | 80.77% | 98.95% |
| CHEMBL2535 | P11166 | Glucose transporter | 80.59% | 98.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| PubChem | 2483 |
| LOTUS | LTS0143625 |
| wikiData | Q27164063 |