2-(3,4-Dihydroxyphenyl)-5-hydroxy-7-[3,4,5-trihydroxy-6-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxymethyl]oxan-2-yl]oxychromen-4-one
Internal ID | e1058e58-7341-4866-bab3-0d1084a39c36 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-7-O-glycosides |
IUPAC Name | 2-(3,4-dihydroxyphenyl)-5-hydroxy-7-[3,4,5-trihydroxy-6-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxymethyl]oxan-2-yl]oxychromen-4-one |
SMILES (Canonical) | CC1C(C(C(C(O1)OCC2C(C(C(C(O2)OC3=CC(=C4C(=C3)OC(=CC4=O)C5=CC(=C(C=C5)O)O)O)O)O)O)O)O)O |
SMILES (Isomeric) | CC1C(C(C(C(O1)OCC2C(C(C(C(O2)OC3=CC(=C4C(=C3)OC(=CC4=O)C5=CC(=C(C=C5)O)O)O)O)O)O)O)O)O |
InChI | InChI=1S/C27H30O15/c1-9-20(32)22(34)24(36)26(39-9)38-8-18-21(33)23(35)25(37)27(42-18)40-11-5-14(30)19-15(31)7-16(41-17(19)6-11)10-2-3-12(28)13(29)4-10/h2-7,9,18,20-30,32-37H,8H2,1H3 |
InChI Key | MGYBYJXAXUBTQF-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C27H30O15 |
Molecular Weight | 594.50 g/mol |
Exact Mass | 594.15847025 g/mol |
Topological Polar Surface Area (TPSA) | 245.00 Ų |
XlogP | -1.10 |
HMS3356K20 |
FT-0777971 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.65% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 99.61% | 91.49% |
CHEMBL2581 | P07339 | Cathepsin D | 97.33% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 96.45% | 89.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 95.36% | 94.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 95.31% | 99.15% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.13% | 86.33% |
CHEMBL3401 | O75469 | Pregnane X receptor | 93.65% | 94.73% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 91.10% | 97.36% |
CHEMBL3194 | P02766 | Transthyretin | 88.09% | 90.71% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 88.08% | 85.14% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.48% | 97.09% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.21% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.07% | 95.56% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 84.64% | 86.92% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 84.39% | 95.78% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 84.04% | 90.71% |
CHEMBL1907 | P15144 | Aminopeptidase N | 82.40% | 93.31% |
CHEMBL1075162 | Q13304 | Uracil nucleotide/cysteinyl leukotriene receptor | 80.72% | 80.33% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.71% | 95.89% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.34% | 99.17% |
CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 80.33% | 93.65% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 12315422 |
LOTUS | LTS0190690 |
wikiData | Q105163646 |