2-Phenylfuro[2,3-h]chromen-4-one
| Internal ID | 3eb7a8e7-b41a-4fe0-b43e-3df5ca1df856 |
| Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavones > Furanoflavones |
| IUPAC Name | 2-phenylfuro[2,3-h]chromen-4-one |
| SMILES (Canonical) | C1=CC=C(C=C1)C2=CC(=O)C3=C(O2)C4=C(C=C3)OC=C4 |
| SMILES (Isomeric) | C1=CC=C(C=C1)C2=CC(=O)C3=C(O2)C4=C(C=C3)OC=C4 |
| InChI | InChI=1S/C17H10O3/c18-14-10-16(11-4-2-1-3-5-11)20-17-12(14)6-7-15-13(17)8-9-19-15/h1-10H |
| InChI Key | NQNOTBRHBRJKKH-UHFFFAOYSA-N |
| Popularity | 26 references in papers |
| Molecular Formula | C17H10O3 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.062994177 g/mol |
| Topological Polar Surface Area (TPSA) | 39.40 Ų |
| XlogP | 3.60 |
| 7,8-(Oxyvinylene)flavone |
| 2-phenylfuro[2,3-h]chromen-4-one |
| 482-00-8 |
| CHEMBL224157 |
| SCHEMBL1161113 |
| BDBM50548258 |
| Lanceolatin B, >=95% (LC/MS-UV) |
![2D Structure of 2-Phenylfuro[2,3-h]chromen-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/2-phenylfuro23-hchromen-4-one.jpg "2D Structure of 2-Phenylfuro[2,3-h]chromen-4-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.03% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.73% | 98.95% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 94.42% | 91.49% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.77% | 95.56% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.92% | 89.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.38% | 99.23% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.76% | 86.33% |
| CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 87.13% | 94.03% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 84.20% | 92.08% |
| CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 81.17% | 85.94% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.88% | 94.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Dahlstedtia pinnata |
| Lonchocarpus heptaphyllus |
| Millettia erythrocalyx |
| Millettia peguensis |
| Millettia pulchra |
| Millettia sanagana |
| Pongamia pinnata |
| Tephrosia falciformis |
| Tephrosia purpurea |
| PubChem | 10978265 |
| LOTUS | LTS0076400 |
| wikiData | Q104397701 |