2-Isoprenylemodin
Internal ID | 21593f97-e1fc-4710-ab8d-1b0f4cb94b0c |
Taxonomy | Benzenoids > Anthracenes > Anthraquinones > Hydroxyanthraquinones |
IUPAC Name | 1,3,8-trihydroxy-6-methyl-2-(3-methylbut-2-enyl)anthracene-9,10-dione |
SMILES (Canonical) | CC1=CC2=C(C(=C1)O)C(=O)C3=C(C(=C(C=C3C2=O)O)CC=C(C)C)O |
SMILES (Isomeric) | CC1=CC2=C(C(=C1)O)C(=O)C3=C(C(=C(C=C3C2=O)O)CC=C(C)C)O |
InChI | InChI=1S/C20H18O5/c1-9(2)4-5-11-14(21)8-13-17(19(11)24)20(25)16-12(18(13)23)6-10(3)7-15(16)22/h4,6-8,21-22,24H,5H2,1-3H3 |
InChI Key | WQTDARJAYXTHNU-UHFFFAOYSA-N |
Popularity | 2 references in papers |
Molecular Formula | C20H18O5 |
Molecular Weight | 338.40 g/mol |
Exact Mass | 338.11542367 g/mol |
Topological Polar Surface Area (TPSA) | 94.80 Ų |
XlogP | 4.60 |
82345-58-2 |
2-isopentenylemodine |
CHEBI:1177 |
SCHEMBL4740670 |
DTXSID30331935 |
LMPK13040010 |
Q27105418 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1951 | P21397 | Monoamine oxidase A | 98.21% | 91.49% |
CHEMBL2581 | P07339 | Cathepsin D | 97.55% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.41% | 91.11% |
CHEMBL3401 | O75469 | Pregnane X receptor | 94.19% | 94.73% |
CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 92.20% | 89.34% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.85% | 95.56% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.76% | 89.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.68% | 99.23% |
CHEMBL4208 | P20618 | Proteasome component C5 | 85.70% | 90.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 85.32% | 85.14% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 83.17% | 97.21% |
CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 82.57% | 96.90% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.28% | 90.71% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 80.86% | 99.15% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.59% | 96.00% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 80.54% | 91.71% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 80.31% | 95.17% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 80.12% | 95.64% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Populus balsamifera |
Psorospermum febrifugum |
Psorospermum glaberrimum |
Psorospermum tenuifolium |
Salix purpurea |
Salix sericea |
PubChem | 442750 |
LOTUS | LTS0054392 |
wikiData | Q104972728 |