2-(4,8-dimethylnona-1,3,7-trienyl)-2,3,9-trimethyl-3H-furo[3,2-c]chromen-4-one
Internal ID | 15d69b0f-aecb-415a-a532-bef577024ee0 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones |
IUPAC Name | 2-(4,8-dimethylnona-1,3,7-trienyl)-2,3,9-trimethyl-3H-furo[3,2-c]chromen-4-one |
SMILES (Canonical) | CC1C2=C(C3=C(C=CC=C3OC2=O)C)OC1(C)C=CC=C(C)CCC=C(C)C |
SMILES (Isomeric) | CC1C2=C(C3=C(C=CC=C3OC2=O)C)OC1(C)C=CC=C(C)CCC=C(C)C |
InChI | InChI=1S/C25H30O3/c1-16(2)10-7-11-17(3)12-9-15-25(6)19(5)22-23(28-25)21-18(4)13-8-14-20(21)27-24(22)26/h8-10,12-15,19H,7,11H2,1-6H3 |
InChI Key | MYDHIEBHOGWYCY-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C25H30O3 |
Molecular Weight | 378.50 g/mol |
Exact Mass | 378.21949481 g/mol |
Topological Polar Surface Area (TPSA) | 35.50 Ų |
XlogP | 6.60 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.67% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 96.13% | 98.95% |
CHEMBL3401 | O75469 | Pregnane X receptor | 94.96% | 94.73% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.38% | 86.33% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.84% | 89.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.24% | 94.45% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.11% | 95.56% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.53% | 99.23% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 84.93% | 92.08% |
CHEMBL3492 | P49721 | Proteasome Macropain subunit | 83.87% | 90.24% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.62% | 97.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.03% | 99.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Fragaria × ananassa |
Ipomoea nil |
Matthiola incana |
Nassauvia pyramidalis |
Petunia exserta |
Punica granatum |
Rubus parviflorus |
PubChem | 163009330 |
LOTUS | LTS0191892 |
wikiData | Q104391015 |