1,6,6-Trimethyl-1,2,6,7,8,9-hexahydrophenanthro[1,2-b]furan-10,11-dione
Internal ID | 30044a76-4517-4c56-9230-d0ff06e75b5b |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids > Tanshinones, isotanshinones, and derivatives |
IUPAC Name | 1,6,6-trimethyl-2,7,8,9-tetrahydro-1H-naphtho[1,2-g][1]benzofuran-10,11-dione |
SMILES (Canonical) | CC1COC2=C1C(=O)C(=O)C3=C2C=CC4=C3CCCC4(C)C |
SMILES (Isomeric) | CC1COC2=C1C(=O)C(=O)C3=C2C=CC4=C3CCCC4(C)C |
InChI | InChI=1S/C19H20O3/c1-10-9-22-18-12-6-7-13-11(5-4-8-19(13,2)3)15(12)17(21)16(20)14(10)18/h6-7,10H,4-5,8-9H2,1-3H3 |
InChI Key | GVKKJJOMQCNPGB-UHFFFAOYSA-N |
Popularity | 10 references in papers |
Molecular Formula | C19H20O3 |
Molecular Weight | 296.40 g/mol |
Exact Mass | 296.14124450 g/mol |
Topological Polar Surface Area (TPSA) | 43.40 Ų |
XlogP | 3.80 |
Atomic LogP (AlogP) | 3.44 |
H-Bond Acceptor | 3 |
H-Bond Donor | 0 |
Rotatable Bonds | 0 |
1,6,6-Trimethyl-1,2,6,7,8,9-hexahydrophenanthro[1,2-b]furan-10,11-dione |
(-)-1,2,6,7,8,9,10,11-Octahydro-1,6,6-trimethylphenanthro[1,2-b]furan-10,11-dione |
1,6,6-trimethyl-1H,2H,6H,7H,8H,9H,10H,11H-phenanthro[1,2-b]furan-10,11-dione |
1,6,6-trimethyl-2,7,8,9-tetrahydro-1H-naphtho[1,2-g][1]benzofuran-10,11-dione |
(-)-Cryptotanshinone |
Cryptotanshinon;Tanshinone c |
Cryototanshinone |
MFCD07636810 |
NSC686518 |
4733-35-1 |
There are more than 10 synonyms. If you wish to see them all click here. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 1.0000 | 100.00% |
Caco-2 | + | 0.8854 | 88.54% |
Blood Brain Barrier | + | 0.7500 | 75.00% |
Human oral bioavailability | + | 0.5429 | 54.29% |
Subcellular localzation | Mitochondria | 0.8192 | 81.92% |
OATP2B1 inhibitior | - | 1.0000 | 100.00% |
OATP1B1 inhibitior | + | 0.8749 | 87.49% |
OATP1B3 inhibitior | + | 0.9682 | 96.82% |
MATE1 inhibitior | - | 0.7200 | 72.00% |
OCT2 inhibitior | - | 0.5000 | 50.00% |
BSEP inhibitior | + | 0.5713 | 57.13% |
P-glycoprotein inhibitior | - | 0.7088 | 70.88% |
P-glycoprotein substrate | - | 0.6123 | 61.23% |
CYP3A4 substrate | + | 0.5978 | 59.78% |
CYP2C9 substrate | - | 1.0000 | 100.00% |
CYP2D6 substrate | - | 0.8299 | 82.99% |
CYP3A4 inhibition | - | 0.8568 | 85.68% |
CYP2C9 inhibition | + | 0.6620 | 66.20% |
CYP2C19 inhibition | + | 0.5621 | 56.21% |
CYP2D6 inhibition | - | 0.7686 | 76.86% |
CYP1A2 inhibition | + | 0.8259 | 82.59% |
CYP2C8 inhibition | - | 0.7859 | 78.59% |
CYP inhibitory promiscuity | + | 0.6029 | 60.29% |
UGT catelyzed | - | 0.0000 | 0.00% |
Carcinogenicity (binary) | - | 0.9300 | 93.00% |
Carcinogenicity (trinary) | Non-required | 0.5138 | 51.38% |
Eye corrosion | - | 0.9873 | 98.73% |
Eye irritation | - | 0.6805 | 68.05% |
Skin irritation | - | 0.6596 | 65.96% |
Skin corrosion | - | 0.9264 | 92.64% |
Ames mutagenesis | + | 0.5700 | 57.00% |
Human Ether-a-go-go-Related Gene inhibition | - | 0.4931 | 49.31% |
Micronuclear | - | 0.7700 | 77.00% |
Hepatotoxicity | - | 0.7625 | 76.25% |
skin sensitisation | - | 0.6618 | 66.18% |
Respiratory toxicity | + | 0.6556 | 65.56% |
Reproductive toxicity | + | 0.6778 | 67.78% |
Mitochondrial toxicity | + | 0.5500 | 55.00% |
Nephrotoxicity | - | 0.8681 | 86.81% |
Acute Oral Toxicity (c) | III | 0.6176 | 61.76% |
Estrogen receptor binding | + | 0.7797 | 77.97% |
Androgen receptor binding | + | 0.6790 | 67.90% |
Thyroid receptor binding | - | 0.4896 | 48.96% |
Glucocorticoid receptor binding | + | 0.6730 | 67.30% |
Aromatase binding | - | 0.6319 | 63.19% |
PPAR gamma | + | 0.8324 | 83.24% |
Honey bee toxicity | - | 0.8846 | 88.46% |
Biodegradation | - | 0.8500 | 85.00% |
Crustacea aquatic toxicity | - | 0.5700 | 57.00% |
Fish aquatic toxicity | + | 0.9967 | 99.67% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] |
28183.8 nM 19952.6 nM |
Potency Potency |
via CMAUP
via CMAUP |
CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase |
544 nM |
Ki |
via Super-PRED
|
CHEMBL3577 | P00352 | Aldehyde dehydrogenase 1A1 |
10000 nM 22387.2 nM |
Potency Potency |
via CMAUP
via CMAUP |
CHEMBL1293236 | P46063 | ATP-dependent DNA helicase Q1 |
12589.3 nM 100000 nM |
Potency Potency |
via CMAUP
via CMAUP |
CHEMBL1293237 | P54132 | Bloom syndrome protein |
39810.7 nM |
Potency |
via CMAUP
|
CHEMBL3180 | O00748 | Carboxylesterase 2 |
141 nM |
Ki |
via Super-PRED
|
CHEMBL3468 | P55210 | Caspase-7 |
25118.9 nM |
Potency |
via CMAUP
|
CHEMBL340 | P08684 | Cytochrome P450 3A4 |
15848.9 nM 15848.9 nM |
Potency Potency |
via CMAUP
via CMAUP |
CHEMBL4159 | Q99714 | Endoplasmic reticulum-associated amyloid beta-peptide-binding protein |
25118.9 nM |
Potency |
via CMAUP
|
CHEMBL1293226 | B2RXH2 | Lysine-specific demethylase 4D-like |
35481.3 nM |
Potency |
via CMAUP
|
CHEMBL1293224 | P10636 | Microtubule-associated protein tau |
891.3 nM 3548.1 nM 3981.1 nM 7943.3 nM 3981.1 nM |
Potency Potency Potency Potency Potency |
via Super-PRED
via CMAUP via CMAUP via CMAUP via CMAUP |
CHEMBL1075138 | Q9NUW8 | Tyrosyl-DNA phosphodiesterase 1 |
17782.8 nM 14125.4 nM |
Potency Potency |
via CMAUP
via CMAUP |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.63% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 96.86% | 98.95% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 95.98% | 91.49% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.51% | 95.56% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 91.95% | 100.00% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 90.16% | 97.25% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.19% | 99.23% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 86.84% | 93.40% |
CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 85.91% | 86.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.47% | 97.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.41% | 86.33% |
CHEMBL5805 | Q9NR97 | Toll-like receptor 8 | 83.95% | 96.25% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.49% | 90.71% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.29% | 95.89% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.23% | 89.00% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 80.14% | 94.80% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 496348 |
NPASS | NPC238861 |
ChEMBL | CHEMBL1518673 |
LOTUS | LTS0256884 |
wikiData | Q105021339 |