1,2,3,4,5-Cyclohexanepentol
| Internal ID | a5340fed-292b-4234-99a7-5a852766e3ae |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Alcohols and polyols > Secondary alcohols > Cyclohexanols |
| IUPAC Name | cyclohexane-1,2,3,4,5-pentol |
| SMILES (Canonical) | C1C(C(C(C(C1O)O)O)O)O |
| SMILES (Isomeric) | C1C(C(C(C(C1O)O)O)O)O |
| InChI | InChI=1S/C6H12O5/c7-2-1-3(8)5(10)6(11)4(2)9/h2-11H,1H2 |
| InChI Key | IMPKVMRTXBRHRB-UHFFFAOYSA-N |
| Popularity | 12 references in papers |
| Molecular Formula | C6H12O5 |
| Molecular Weight | 164.16 g/mol |
| Exact Mass | 164.06847348 g/mol |
| Topological Polar Surface Area (TPSA) | 101.00 Ų |
| XlogP | -2.70 |
| Viburnitol |
| cyclohexane-1,2,3,4,5-pentol |
| 2-Deoxy-myo-inositol |
| Inositol, 1-deoxy- |
| epi-Quercitol |
| cyclohexanepentol |
| 62076-18-0 |
| 2-Deoxy-epi-inositol |
| 1-L-1-deoxy-chiro-inositol |
| TRICLABENDAZOLESULFOXIDE |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.12% | 97.09% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 84.61% | 83.82% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 84.31% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 83.65% | 91.11% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 80.64% | 95.93% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 80.32% | 97.25% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Albertisia delagoensis |
| Aristolochia ridicula |
| Cyclea barbata |
| Legnephora moorei |
| Manilkara hexandra |
| Myrsine pellucida |
| Quercus salicina |
| Viscum album |
| Viscum articulatum |
| Viscum coloratum |
| PubChem | 101715 |
| LOTUS | LTS0134109 |
| wikiData | Q105115843 |