11-Deoxoglycyrrhetinic acid
Internal ID | 8bd51fc4-4a94-439e-9d8b-531e5375c91d |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | (2S,4aS,6aR,6aS,6bR,8aR,10S,12aR,14bR)-10-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-2-carboxylic acid |
SMILES (Canonical) | CC1(C2CCC3(C(C2(CCC1O)C)CC=C4C3(CCC5(C4CC(CC5)(C)C(=O)O)C)C)C)C |
SMILES (Isomeric) | C[C@]12CC[C@](C[C@H]1C3=CC[C@@H]4[C@]5(CC[C@@H](C([C@@H]5CC[C@]4([C@@]3(CC2)C)C)(C)C)O)C)(C)C(=O)O |
InChI | InChI=1S/C30H48O3/c1-25(2)21-10-13-30(7)22(28(21,5)12-11-23(25)31)9-8-19-20-18-27(4,24(32)33)15-14-26(20,3)16-17-29(19,30)6/h8,20-23,31H,9-18H2,1-7H3,(H,32,33)/t20-,21-,22+,23-,26+,27-,28-,29+,30+/m0/s1 |
InChI Key | JZFSMVXQUWRSIW-BTJIZOSBSA-N |
Popularity | 15 references in papers |
Molecular Formula | C30H48O3 |
Molecular Weight | 456.70 g/mol |
Exact Mass | 456.36034539 g/mol |
Topological Polar Surface Area (TPSA) | 57.50 Ų |
XlogP | 7.50 |
564-16-9 |
11-Deoxo-18beta-glycyrrhetic acid |
11-Deoxoglycyrrhetic acid |
CHEMBL487933 |
(2S,4aS,6aR,6aS,6bR,8aR,10S,12aR,14bR)-10-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-2-carboxylic acid |
3alpha-hydroxyolean-12-en-30-oic acid |
(2S,4aS,6aS,6bR,8aR,10S,12aR,12bR,14bR)-10-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-1,2,3,4,4a,5,6,6a,6b,7,8,8a,9,10,11,12,12a,12b,13,14b-icosahydropicene-2-carboxylic acid |
Anaphalisoleanenoic acid |
11-Desoxoglycyrrhetinsaure |
11-Deoxyglycyrrhetinic acid |
There are more than 10 synonyms. If you wish to see them all click here. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase |
10530 nM |
IC50 |
PMID: 26900660
|
CHEMBL3180 | O00748 | Carboxylesterase 2 |
6950 nM |
IC50 |
PMID: 26900660
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL221 | P23219 | Cyclooxygenase-1 | 96.29% | 90.17% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.48% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.89% | 94.45% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.65% | 97.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 87.26% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.66% | 95.56% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 85.15% | 93.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.50% | 100.00% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 82.31% | 96.77% |
CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 81.92% | 94.78% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 81.63% | 82.69% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.39% | 91.19% |
CHEMBL2581 | P07339 | Cathepsin D | 81.02% | 98.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Eucommia ulmoides |
Glycyrrhiza |
Glycyrrhiza glabra |
Glycyrrhiza inflata |
PubChem | 12305517 |
NPASS | NPC307426 |
ChEMBL | CHEMBL487933 |
LOTUS | LTS0083526 |
wikiData | Q105137373 |