1-Methylnaphthalene
Internal ID | 3a5ae0d5-1bc7-41f5-a7fc-3c9403778cff |
Taxonomy | Benzenoids > Naphthalenes |
IUPAC Name | 1-methylnaphthalene |
SMILES (Canonical) | CC1=CC=CC2=CC=CC=C12 |
SMILES (Isomeric) | CC1=CC=CC2=CC=CC=C12 |
InChI | InChI=1S/C11H10/c1-9-5-4-7-10-6-2-3-8-11(9)10/h2-8H,1H3 |
InChI Key | QPUYECUOLPXSFR-UHFFFAOYSA-N |
Popularity | 2,509 references in papers |
Molecular Formula | C11H10 |
Molecular Weight | 142.20 g/mol |
Exact Mass | 142.078250319 g/mol |
Topological Polar Surface Area (TPSA) | 0.00 Ų |
XlogP | 3.90 |
90-12-0 |
METHYLNAPHTHALENE |
alpha-Methylnaphthalene |
1321-94-4 |
Naphthalene, 1-methyl- |
Naphthalene, methyl- |
1-methyl-naphthalene |
alpha-methyl naphthalenes |
Methyl naphthalene |
1-Methylnapththalene |
There are more than 10 synonyms. If you wish to see them all click here. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL3577 | P00352 | Aldehyde dehydrogenase 1A1 |
39810.7 nM |
Potency |
via CMAUP
|
CHEMBL5282 | P11509 | Cytochrome P450 2A6 |
34000 nM 33962.53 nM |
IC50 IC50 |
PMID: 15658857
PMID: 19110342 |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.48% | 95.56% |
CHEMBL3401 | O75469 | Pregnane X receptor | 88.35% | 94.73% |
CHEMBL3085 | P43003 | Excitatory amino acid transporter 1 | 87.86% | 94.67% |
CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 87.61% | 93.65% |
CHEMBL240 | Q12809 | HERG | 86.63% | 89.76% |
CHEMBL1936 | P10721 | Stem cell growth factor receptor | 84.13% | 84.17% |
CHEMBL1907 | P15144 | Aminopeptidase N | 84.00% | 93.31% |
CHEMBL3227 | P41594 | Metabotropic glutamate receptor 5 | 83.21% | 96.42% |
CHEMBL5805 | Q9NR97 | Toll-like receptor 8 | 82.24% | 96.25% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 82.05% | 91.11% |
CHEMBL3959 | P16083 | Quinone reductase 2 | 81.15% | 89.49% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.27% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 80.18% | 98.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 7002 |
NPASS | NPC139416 |
ChEMBL | CHEMBL383808 |
LOTUS | LTS0214302 |
wikiData | Q161656 |