1-Methyl-2-phenyl-4(1H)-quinolinone
Internal ID | 6ed46274-9961-4793-a84d-d106990003be |
Taxonomy | Organoheterocyclic compounds > Quinolines and derivatives > Phenylquinolines |
IUPAC Name | 1-methyl-2-phenylquinolin-4-one |
SMILES (Canonical) | CN1C2=CC=CC=C2C(=O)C=C1C3=CC=CC=C3 |
SMILES (Isomeric) | CN1C2=CC=CC=C2C(=O)C=C1C3=CC=CC=C3 |
InChI | InChI=1S/C16H13NO/c1-17-14-10-6-5-9-13(14)16(18)11-15(17)12-7-3-2-4-8-12/h2-11H,1H3 |
InChI Key | AFKNCQDBTBDPOQ-UHFFFAOYSA-N |
Popularity | 26 references in papers |
Molecular Formula | C16H13NO |
Molecular Weight | 235.28 g/mol |
Exact Mass | 235.099714038 g/mol |
Topological Polar Surface Area (TPSA) | 20.30 Ų |
XlogP | 3.30 |
1-methyl-2-phenylquinolin-4(1h)-one |
1-methyl-2-phenylquinolin-4-one |
17182-60-4 |
4(1H)-Quinolinone, 1-methyl-2-phenyl- |
CHEMBL277048 |
MLS000106879 |
1-Methyl-2-phenyl-1H-quinolin-4-one |
Cambridge id 5471783 |
Oprea1_072190 |
Oprea1_817692 |
There are more than 10 synonyms. If you wish to see them all click here. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] |
25118.9 nM |
Potency |
via CMAUP
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 97.68% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 97.51% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.54% | 86.33% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 88.93% | 93.99% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.67% | 89.00% |
CHEMBL1899 | P46098 | Serotonin 3a (5-HT3a) receptor | 86.93% | 100.00% |
CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 83.90% | 92.67% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 83.85% | 85.14% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 81.93% | 92.08% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 81.83% | 96.09% |
CHEMBL5805 | Q9NR97 | Toll-like receptor 8 | 80.14% | 96.25% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 776143 |
NPASS | NPC257490 |
ChEMBL | CHEMBL277048 |
LOTUS | LTS0219286 |
wikiData | Q83038824 |