1-Methyl-2-nonylquinolin-4(1H)-one
| Internal ID | b6364de1-13e2-44a4-8a61-67e62aa0c571 |
| Taxonomy | Organoheterocyclic compounds > Quinolines and derivatives > Quinolones and derivatives > Hydroquinolones |
| IUPAC Name | 1-methyl-2-nonylquinolin-4-one |
| SMILES (Canonical) | CCCCCCCCCC1=CC(=O)C2=CC=CC=C2N1C |
| SMILES (Isomeric) | CCCCCCCCCC1=CC(=O)C2=CC=CC=C2N1C |
| InChI | InChI=1S/C19H27NO/c1-3-4-5-6-7-8-9-12-16-15-19(21)17-13-10-11-14-18(17)20(16)2/h10-11,13-15H,3-9,12H2,1-2H3 |
| InChI Key | XIGBBPQAXHSVSN-UHFFFAOYSA-N |
| Popularity | 7 references in papers |
| Molecular Formula | C19H27NO |
| Molecular Weight | 285.40 g/mol |
| Exact Mass | 285.209264485 g/mol |
| Topological Polar Surface Area (TPSA) | 20.30 Ų |
| XlogP | 6.10 |
| 68353-24-2 |
| 1-METHYL-2-NONYLQUINOLIN-4-ONE |
| 1-methyl-2-nonyl-4(1h)-quinolinone |
| 1-Methyl-2-nonyl-4-quinolinone |
| 1-Methyl-2-nonyl-4(1H)-quinolone |
| 1-Methyl-2-nonyl-4(1H)-quinolinone; 1-Methyl-2-n-nonyl-4(1H) quinolone; 1-Methyl-2-nonyl-4(1H)-quinolone |
| DTXSID90553439 |
| CHEBI:174025 |
| AKOS025288422 |
| FS-8763 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.12% | 98.95% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 97.53% | 92.08% |
| CHEMBL240 | Q12809 | HERG | 96.83% | 89.76% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.64% | 95.56% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 94.34% | 93.99% |
| CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 93.94% | 85.94% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 93.35% | 89.63% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.81% | 86.33% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 92.67% | 98.59% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 88.83% | 97.25% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.91% | 96.09% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 87.52% | 94.73% |
| CHEMBL5805 | Q9NR97 | Toll-like receptor 8 | 87.41% | 96.25% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 86.62% | 83.82% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 85.97% | 91.11% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.31% | 89.00% |
| CHEMBL1899 | P46098 | Serotonin 3a (5-HT3a) receptor | 83.98% | 100.00% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 83.69% | 93.31% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 83.44% | 82.69% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 83.39% | 91.81% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.41% | 99.17% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 81.97% | 93.65% |
| CHEMBL1781 | P11387 | DNA topoisomerase I | 80.81% | 97.00% |
| CHEMBL2885 | P07451 | Carbonic anhydrase III | 80.68% | 87.45% |
| CHEMBL1978 | P11511 | Cytochrome P450 19A1 | 80.06% | 91.76% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Haplophyllum tuberculatum |
| Raulinoa echinata |
| Ruta graveolens |
| PubChem | 13967189 |
| LOTUS | LTS0222980 |
| wikiData | Q82434023 |