1-(3,4-Dimethoxyphenyl)-6,7-dimethoxy-2,3-bis(methoxymethyl)-1,2,3,4-tetrahydronaphthalene
Internal ID | 22f185ab-8be9-48a3-8469-97dd9a3e79f5 |
Taxonomy | Lignans, neolignans and related compounds > Aryltetralin lignans |
IUPAC Name | 1-(3,4-dimethoxyphenyl)-6,7-dimethoxy-2,3-bis(methoxymethyl)-1,2,3,4-tetrahydronaphthalene |
SMILES (Canonical) | COCC1CC2=CC(=C(C=C2C(C1COC)C3=CC(=C(C=C3)OC)OC)OC)OC |
SMILES (Isomeric) | COCC1CC2=CC(=C(C=C2C(C1COC)C3=CC(=C(C=C3)OC)OC)OC)OC |
InChI | InChI=1S/C24H32O6/c1-25-13-17-9-16-11-22(29-5)23(30-6)12-18(16)24(19(17)14-26-2)15-7-8-20(27-3)21(10-15)28-4/h7-8,10-12,17,19,24H,9,13-14H2,1-6H3 |
InChI Key | CZZKSEXMNQGXJU-UHFFFAOYSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C24H32O6 |
Molecular Weight | 416.50 g/mol |
Exact Mass | 416.21988874 g/mol |
Topological Polar Surface Area (TPSA) | 55.40 Ų |
XlogP | 3.80 |
There are no found synonyms. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.60% | 96.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.80% | 85.14% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 93.79% | 92.94% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.87% | 97.09% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 90.61% | 89.62% |
CHEMBL2581 | P07339 | Cathepsin D | 89.84% | 98.95% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 89.83% | 93.99% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 89.20% | 91.11% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.66% | 95.89% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.33% | 86.33% |
CHEMBL2535 | P11166 | Glucose transporter | 84.86% | 98.75% |
CHEMBL3438 | Q05513 | Protein kinase C zeta | 83.94% | 88.48% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.57% | 99.17% |
CHEMBL4208 | P20618 | Proteasome component C5 | 82.67% | 90.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.46% | 95.89% |
CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 81.74% | 94.03% |
CHEMBL5925 | P22413 | Ectonucleotide pyrophosphatase/phosphodiesterase family member 1 | 80.75% | 92.38% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Phyllanthus amarus |
Phyllanthus niruri |
Phyllanthus urinaria |
PubChem | 13318863 |
LOTUS | LTS0075121 |
wikiData | Q104973334 |