(1S,2S,4S,5'R,6R,7S,8R,9S,12S,13R,15R,16R,18R,19R)-5',7,9,13-tetramethyl-15-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-6,2'-oxane]-16,18,19-triol
Internal ID | de903d1f-4d9f-45e8-826d-4ccfeebd8c5f |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins |
IUPAC Name | (1S,2S,4S,5'R,6R,7S,8R,9S,12S,13R,15R,16R,18R,19R)-5',7,9,13-tetramethyl-15-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-6,2'-oxane]-16,18,19-triol |
SMILES (Canonical) | CC1CCC2(C(C3C(O2)CC4C3(CCC5C4CC(C6(C5(CC(C(C6)O)OC7C(C(C(C(O7)CO)O)O)O)C)O)O)C)C)OC1 |
SMILES (Isomeric) | C[C@@H]1CC[C@@]2([C@H]([C@H]3[C@@H](O2)C[C@@H]4[C@@]3(CC[C@H]5[C@H]4C[C@H]([C@@]6([C@@]5(C[C@H]([C@@H](C6)O)O[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)CO)O)O)O)C)O)O)C)C)OC1 |
InChI | InChI=1S/C33H54O11/c1-15-5-8-33(41-14-15)16(2)25-21(44-33)10-19-17-9-24(36)32(40)11-20(35)22(12-31(32,4)18(17)6-7-30(19,25)3)42-29-28(39)27(38)26(37)23(13-34)43-29/h15-29,34-40H,5-14H2,1-4H3/t15-,16+,17-,18+,19+,20-,21+,22-,23-,24-,25+,26-,27+,28-,29-,30+,31-,32+,33-/m1/s1 |
InChI Key | SZSOLMOJQBRGCV-NPOLDFOASA-N |
Popularity | 4 references in papers |
Molecular Formula | C33H54O11 |
Molecular Weight | 626.80 g/mol |
Exact Mass | 626.36661253 g/mol |
Topological Polar Surface Area (TPSA) | 179.00 Ų |
XlogP | 1.50 |
There are no found synonyms. |
![2D Structure of (1S,2S,4S,5'R,6R,7S,8R,9S,12S,13R,15R,16R,18R,19R)-5',7,9,13-tetramethyl-15-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-6,2'-oxane]-16,18,19-triol 2D Structure of (1S,2S,4S,5'R,6R,7S,8R,9S,12S,13R,15R,16R,18R,19R)-5',7,9,13-tetramethyl-15-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-6,2'-oxane]-16,18,19-triol](https://plantaedb.com/storage/docs/compounds/2023/11/0cb16320-82c1-11ee-8c77-0781eb2ae231.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.24% | 96.09% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 96.24% | 96.61% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.51% | 97.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.47% | 91.11% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.52% | 97.25% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 93.30% | 95.93% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 93.00% | 92.86% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 92.92% | 100.00% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 92.23% | 95.50% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 92.03% | 96.21% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 91.32% | 89.05% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.74% | 85.14% |
CHEMBL4618 | P09960 | Leukotriene A4 hydrolase | 88.81% | 97.86% |
CHEMBL237 | P41145 | Kappa opioid receptor | 88.79% | 98.10% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.86% | 94.45% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 85.98% | 92.50% |
CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 85.74% | 100.00% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 85.67% | 90.17% |
CHEMBL259 | P32245 | Melanocortin receptor 4 | 85.65% | 95.38% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.50% | 95.89% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 85.21% | 95.89% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 84.89% | 91.24% |
CHEMBL204 | P00734 | Thrombin | 84.86% | 96.01% |
CHEMBL1163125 | O60885 | Bromodomain-containing protein 4 | 84.33% | 97.31% |
CHEMBL2095194 | P08709 | Coagulation factor VII/tissue factor | 83.65% | 99.17% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 83.64% | 100.00% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 83.62% | 96.95% |
CHEMBL5524 | Q99873 | Protein-arginine N-methyltransferase 1 | 83.57% | 96.67% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 82.55% | 95.83% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 82.42% | 92.94% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 81.68% | 86.92% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 81.52% | 97.33% |
CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 81.22% | 95.58% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 81.06% | 97.28% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.92% | 89.00% |
CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 80.43% | 92.32% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.33% | 86.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Allium giganteum |
Allium karataviense |
Allium macleanii |
PubChem | 15693810 |
LOTUS | LTS0207408 |
wikiData | Q105264383 |