(-)-Dicentrine
Internal ID | 16559b16-96c1-4531-a1d2-a762b61bc604 |
Taxonomy | Alkaloids and derivatives > Aporphines |
IUPAC Name | (12R)-16,17-dimethoxy-11-methyl-3,5-dioxa-11-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1(20),2(6),7,14,16,18-hexaene |
SMILES (Canonical) | CN1CCC2=CC3=C(C4=C2C1CC5=CC(=C(C=C54)OC)OC)OCO3 |
SMILES (Isomeric) | CN1CCC2=CC3=C(C4=C2[C@H]1CC5=CC(=C(C=C54)OC)OC)OCO3 |
InChI | InChI=1S/C20H21NO4/c1-21-5-4-11-7-17-20(25-10-24-17)19-13-9-16(23-3)15(22-2)8-12(13)6-14(21)18(11)19/h7-9,14H,4-6,10H2,1-3H3/t14-/m1/s1 |
InChI Key | YJWBWQWUHVXPNC-CQSZACIVSA-N |
Popularity | 38 references in papers |
Molecular Formula | C20H21NO4 |
Molecular Weight | 339.40 g/mol |
Exact Mass | 339.14705815 g/mol |
Topological Polar Surface Area (TPSA) | 40.20 Ų |
XlogP | 3.20 |
Atomic LogP (AlogP) | 3.18 |
H-Bond Acceptor | 5 |
H-Bond Donor | 0 |
Rotatable Bonds | 2 |
Dicentrine, (-)- |
L-DICENTRINE |
28832-07-7 |
(R)-(-)-Dicentrine |
NSC-251699 |
Dicentrine L-form [MI] |
NSC251699 |
MLS000575015 |
UNII-5O9KK11109 |
5O9KK11109 |
There are more than 10 synonyms. If you wish to see them all click here. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.9459 | 94.59% |
Caco-2 | + | 0.9386 | 93.86% |
Blood Brain Barrier | + | 0.8750 | 87.50% |
Human oral bioavailability | - | 0.5714 | 57.14% |
Subcellular localzation | Lysosomes | 0.5163 | 51.63% |
OATP2B1 inhibitior | - | 1.0000 | 100.00% |
OATP1B1 inhibitior | + | 0.9281 | 92.81% |
OATP1B3 inhibitior | + | 0.9514 | 95.14% |
MATE1 inhibitior | - | 0.9000 | 90.00% |
OCT2 inhibitior | - | 0.5500 | 55.00% |
BSEP inhibitior | + | 0.7254 | 72.54% |
P-glycoprotein inhibitior | - | 0.6307 | 63.07% |
P-glycoprotein substrate | - | 0.7194 | 71.94% |
CYP3A4 substrate | + | 0.6112 | 61.12% |
CYP2C9 substrate | - | 0.6129 | 61.29% |
CYP2D6 substrate | + | 0.7342 | 73.42% |
CYP3A4 inhibition | + | 0.6228 | 62.28% |
CYP2C9 inhibition | - | 0.8237 | 82.37% |
CYP2C19 inhibition | + | 0.7057 | 70.57% |
CYP2D6 inhibition | + | 0.7688 | 76.88% |
CYP1A2 inhibition | - | 0.7119 | 71.19% |
CYP2C8 inhibition | - | 0.8520 | 85.20% |
CYP inhibitory promiscuity | - | 0.5422 | 54.22% |
UGT catelyzed | - | 0.0000 | 0.00% |
Carcinogenicity (binary) | - | 0.9800 | 98.00% |
Carcinogenicity (trinary) | Non-required | 0.5880 | 58.80% |
Eye corrosion | - | 0.9903 | 99.03% |
Eye irritation | - | 0.9652 | 96.52% |
Skin irritation | - | 0.8002 | 80.02% |
Skin corrosion | - | 0.9489 | 94.89% |
Ames mutagenesis | + | 0.9700 | 97.00% |
Human Ether-a-go-go-Related Gene inhibition | + | 0.7799 | 77.99% |
Micronuclear | - | 0.5200 | 52.00% |
Hepatotoxicity | - | 0.7949 | 79.49% |
skin sensitisation | - | 0.8694 | 86.94% |
Respiratory toxicity | + | 0.7667 | 76.67% |
Reproductive toxicity | + | 0.8778 | 87.78% |
Mitochondrial toxicity | + | 0.8250 | 82.50% |
Nephrotoxicity | - | 0.6923 | 69.23% |
Acute Oral Toxicity (c) | III | 0.7399 | 73.99% |
Estrogen receptor binding | + | 0.6823 | 68.23% |
Androgen receptor binding | - | 0.6037 | 60.37% |
Thyroid receptor binding | + | 0.5850 | 58.50% |
Glucocorticoid receptor binding | + | 0.8325 | 83.25% |
Aromatase binding | - | 0.5181 | 51.81% |
PPAR gamma | + | 0.7505 | 75.05% |
Honey bee toxicity | - | 0.7798 | 77.98% |
Biodegradation | - | 0.9500 | 95.00% |
Crustacea aquatic toxicity | + | 0.6200 | 62.00% |
Fish aquatic toxicity | + | 0.9362 | 93.62% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL2362978 | P43351 | DNA repair protein RAD52 homolog |
1180 nM |
AC50 |
via CMAUP
|
CHEMBL1293299 | Q03164 | Histone-lysine N-methyltransferase MLL |
31622.8 nM |
Potency |
via CMAUP
|
CHEMBL1293226 | B2RXH2 | Lysine-specific demethylase 4D-like |
31622.8 nM |
Potency |
via CMAUP
|
CHEMBL1293224 | P10636 | Microtubule-associated protein tau |
15848.9 nM |
Potency |
via CMAUP
|
CHEMBL1293235 | P02545 | Prelamin-A/C |
11220.2 nM |
Potency |
via CMAUP
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.59% | 96.09% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 98.39% | 96.77% |
CHEMBL4247 | Q9UM73 | ALK tyrosine kinase receptor | 92.93% | 96.86% |
CHEMBL5311 | P37023 | Serine/threonine-protein kinase receptor R3 | 92.45% | 82.67% |
CHEMBL5747 | Q92793 | CREB-binding protein | 92.03% | 95.12% |
CHEMBL2581 | P07339 | Cathepsin D | 91.90% | 98.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.73% | 95.56% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 90.67% | 93.40% |
CHEMBL2056 | P21728 | Dopamine D1 receptor | 90.45% | 91.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.65% | 86.33% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 88.62% | 92.62% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.89% | 95.89% |
CHEMBL261 | P00915 | Carbonic anhydrase I | 86.94% | 96.76% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 86.57% | 95.78% |
CHEMBL4895 | P30530 | Tyrosine-protein kinase receptor UFO | 86.53% | 90.95% |
CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 86.34% | 82.38% |
CHEMBL3438 | Q05513 | Protein kinase C zeta | 85.92% | 88.48% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 85.85% | 92.94% |
CHEMBL4208 | P20618 | Proteasome component C5 | 85.85% | 90.00% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 84.97% | 89.62% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 84.92% | 89.50% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 84.40% | 93.99% |
CHEMBL5925 | P22413 | Ectonucleotide pyrophosphatase/phosphodiesterase family member 1 | 84.24% | 92.38% |
CHEMBL217 | P14416 | Dopamine D2 receptor | 84.16% | 95.62% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.80% | 94.00% |
CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 83.67% | 91.79% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.05% | 89.00% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 81.21% | 97.14% |
CHEMBL6031 | Q9H9B1 | Histone-lysine N-methyltransferase, H3 lysine-9 specific 5 | 80.89% | 94.33% |
CHEMBL2535 | P11166 | Glucose transporter | 80.62% | 98.75% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 80.54% | 91.11% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Albertisia delagoensis |
Cissampelos capensis |
Dasymaschalon sootepense |
Glaucium flavum |
Litsea nitida |
Magnolia arcabucoana |
Ocotea leucoxylon |
Sinomenium acutum |
Stephania pierrei |
Stephania tetrandra |
PubChem | 317843 |
NPASS | NPC167546 |
ChEMBL | CHEMBL478754 |
LOTUS | LTS0241812 |
wikiData | Q27262635 |