(-)-Catechin gallate
Internal ID | 64863454-4b9e-4036-bacc-a390bde94dd5 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavans > Catechins > Catechin gallates |
IUPAC Name | [(2S,3R)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3,4-dihydro-2H-chromen-3-yl] 3,4,5-trihydroxybenzoate |
SMILES (Canonical) | C1C(C(OC2=CC(=CC(=C21)O)O)C3=CC(=C(C=C3)O)O)OC(=O)C4=CC(=C(C(=C4)O)O)O |
SMILES (Isomeric) | C1[C@H]([C@@H](OC2=CC(=CC(=C21)O)O)C3=CC(=C(C=C3)O)O)OC(=O)C4=CC(=C(C(=C4)O)O)O |
InChI | InChI=1S/C22H18O10/c23-11-6-14(25)12-8-19(32-22(30)10-4-16(27)20(29)17(28)5-10)21(31-18(12)7-11)9-1-2-13(24)15(26)3-9/h1-7,19,21,23-29H,8H2/t19-,21+/m1/s1 |
InChI Key | LSHVYAFMTMFKBA-CTNGQTDRSA-N |
Popularity | 68 references in papers |
Molecular Formula | C22H18O10 |
Molecular Weight | 442.40 g/mol |
Exact Mass | 442.08999677 g/mol |
Topological Polar Surface Area (TPSA) | 177.00 Ų |
XlogP | 1.50 |
Atomic LogP (AlogP) | 2.53 |
H-Bond Acceptor | 10 |
H-Bond Donor | 7 |
Rotatable Bonds | 3 |
130405-40-2 |
catechin gallate |
(2S,3R)-2-(3,4-Dihydroxyphenyl)-5,7-dihydroxychroman-3-yl 3,4,5-trihydroxybenzoate |
Catechin gallate, (-)- |
UNII-0KT1FO6VO6 |
(-)-catechin 3-o-gallate |
0KT1FO6VO6 |
CCRIS 9303 |
(-)-Catechin 3-gallate |
ent-Catechin 3-O-gallate |
There are more than 10 synonyms. If you wish to see them all click here. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.8422 | 84.22% |
Caco-2 | - | 0.9372 | 93.72% |
Blood Brain Barrier | - | 0.8000 | 80.00% |
Human oral bioavailability | - | 0.7286 | 72.86% |
Subcellular localzation | Mitochondria | 0.6166 | 61.66% |
OATP2B1 inhibitior | + | 0.7032 | 70.32% |
OATP1B1 inhibitior | + | 0.7038 | 70.38% |
OATP1B3 inhibitior | - | 0.5697 | 56.97% |
MATE1 inhibitior | - | 0.7400 | 74.00% |
OCT2 inhibitior | - | 0.8500 | 85.00% |
BSEP inhibitior | - | 0.4828 | 48.28% |
P-glycoprotein inhibitior | - | 0.5530 | 55.30% |
P-glycoprotein substrate | - | 0.8973 | 89.73% |
CYP3A4 substrate | + | 0.5954 | 59.54% |
CYP2C9 substrate | - | 1.0000 | 100.00% |
CYP2D6 substrate | - | 0.7217 | 72.17% |
CYP3A4 inhibition | - | 0.7662 | 76.62% |
CYP2C9 inhibition | - | 0.8369 | 83.69% |
CYP2C19 inhibition | - | 0.8089 | 80.89% |
CYP2D6 inhibition | - | 0.9553 | 95.53% |
CYP1A2 inhibition | - | 0.8058 | 80.58% |
CYP2C8 inhibition | + | 0.7473 | 74.73% |
CYP inhibitory promiscuity | - | 0.8067 | 80.67% |
UGT catelyzed | - | 0.5000 | 50.00% |
Carcinogenicity (binary) | - | 1.0000 | 100.00% |
Carcinogenicity (trinary) | Non-required | 0.6339 | 63.39% |
Eye corrosion | - | 0.9906 | 99.06% |
Eye irritation | + | 0.6035 | 60.35% |
Skin irritation | - | 0.6348 | 63.48% |
Skin corrosion | - | 0.9587 | 95.87% |
Ames mutagenesis | + | 0.5100 | 51.00% |
Human Ether-a-go-go-Related Gene inhibition | + | 0.8554 | 85.54% |
Micronuclear | + | 0.8859 | 88.59% |
Hepatotoxicity | + | 0.6250 | 62.50% |
skin sensitisation | - | 0.8369 | 83.69% |
Respiratory toxicity | + | 0.6333 | 63.33% |
Reproductive toxicity | + | 0.8444 | 84.44% |
Mitochondrial toxicity | + | 0.6625 | 66.25% |
Nephrotoxicity | - | 0.7481 | 74.81% |
Acute Oral Toxicity (c) | IV | 0.3764 | 37.64% |
Estrogen receptor binding | + | 0.7558 | 75.58% |
Androgen receptor binding | + | 0.8604 | 86.04% |
Thyroid receptor binding | + | 0.6077 | 60.77% |
Glucocorticoid receptor binding | + | 0.6545 | 65.45% |
Aromatase binding | - | 0.8091 | 80.91% |
PPAR gamma | + | 0.6090 | 60.90% |
Honey bee toxicity | - | 0.8279 | 82.79% |
Biodegradation | - | 0.8250 | 82.50% |
Crustacea aquatic toxicity | + | 0.5750 | 57.50% |
Fish aquatic toxicity | + | 0.9197 | 91.97% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL3404 | P52209 | 6-phosphogluconate dehydrogenase |
1280 nM |
IC50 |
PMID: 18313308
|
CHEMBL4860 | P10415 | Apoptosis regulator Bcl-2 |
400 nM 230 nM |
Ki Ki |
via Super-PRED
via Super-PRED |
CHEMBL1293236 | P46063 | ATP-dependent DNA helicase Q1 |
707.9 nM |
Potency |
via Super-PRED
|
CHEMBL4822 | P56817 | Beta-secretase 1 |
6000 nM |
IC50 |
PMID: 14592472
|
CHEMBL2362978 | P43351 | DNA repair protein RAD52 homolog |
255 nM |
IC50 |
via Super-PRED
|
CHEMBL4662 | P28074 | Proteasome Macropain subunit MB1 |
194 nM 124 nM |
IC50 IC50 |
via Super-PRED
via Super-PRED |
CHEMBL1075138 | Q9NUW8 | Tyrosyl-DNA phosphodiesterase 1 |
281.8 nM |
Potency |
via Super-PRED
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3404 | P52209 | 6-phosphogluconate dehydrogenase | 99.96% | 0.00% |
CHEMBL4822 | P56817 | Beta-secretase 1 | 99.96% | 0.00% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.49% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 99.32% | 91.49% |
CHEMBL3194 | P02766 | Transthyretin | 96.50% | 90.71% |
CHEMBL4860 | P10415 | Apoptosis regulator Bcl-2 | 92.86% | 0.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.67% | 96.09% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 92.47% | 83.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.88% | 97.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.49% | 86.33% |
CHEMBL260 | Q16539 | MAP kinase p38 alpha | 89.54% | 0.00% |
CHEMBL3004 | P33527 | Multidrug resistance-associated protein 1 | 88.53% | 96.37% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.40% | 99.23% |
CHEMBL245 | P20309 | Muscarinic acetylcholine receptor M3 | 87.25% | 97.53% |
CHEMBL2535 | P11166 | Glucose transporter | 86.71% | 98.75% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.67% | 89.00% |
CHEMBL2487 | P05067 | Beta amyloid A4 protein | 86.22% | 0.00% |
CHEMBL1993 | P26358 | DNA (cytosine-5)-methyltransferase 1 | 86.22% | 0.00% |
CHEMBL2292 | Q13627 | Dual-specificity tyrosine-phosphorylation regulated kinase 1A | 86.22% | 0.00% |
CHEMBL3717 | P08581 | Hepatocyte growth factor receptor | 86.22% | 0.00% |
CHEMBL3869 | P50281 | Matrix metalloproteinase 14 | 86.22% | 0.00% |
CHEMBL333 | P08253 | Matrix metalloproteinase-2 | 86.22% | 0.00% |
CHEMBL1293224 | P10636 | Microtubule-associated protein tau | 86.22% | 0.00% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 86.22% | 0.00% |
CHEMBL6101 | P42224 | Signal transducer and activator of transcription 1-alpha/beta | 86.22% | 0.00% |
CHEMBL3592 | Q14534 | Squalene monooxygenase | 86.22% | 0.00% |
CHEMBL2916 | O14746 | Telomerase reverse transcriptase | 86.22% | 0.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.66% | 99.17% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.58% | 95.56% |
CHEMBL4208 | P20618 | Proteasome component C5 | 82.85% | 90.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 82.82% | 99.15% |
CHEMBL2581 | P07339 | Cathepsin D | 82.77% | 98.95% |
CHEMBL3596077 | Q11130 | Alpha-(1,3)-fucosyltransferase 7 | 81.24% | 0.00% |
CHEMBL3596076 | Q11203 | CMP-N-acetylneuraminate-beta-1,4-galactoside alpha-2,3-sialyltransferase | 81.24% | 0.00% |
CHEMBL4996 | P22083 | Fucosyltransferase 4 | 81.24% | 0.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.58% | 91.19% |
CHEMBL240 | Q12809 | HERG | 59.61% | 0.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 6419835 |
NPASS | NPC289322 |
ChEMBL | CHEMBL129451 |
LOTUS | LTS0216303 |
wikiData | Q27145773 |