(+)-Camptothecin
Internal ID | db2bbe61-dcf2-434b-8988-38af3a93fceb |
Taxonomy | Alkaloids and derivatives > Camptothecins |
IUPAC Name | 19-ethyl-19-hydroxy-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaene-14,18-dione |
SMILES (Canonical) | CCC1(C2=C(COC1=O)C(=O)N3CC4=CC5=CC=CC=C5N=C4C3=C2)O |
SMILES (Isomeric) | CCC1(C2=C(COC1=O)C(=O)N3CC4=CC5=CC=CC=C5N=C4C3=C2)O |
InChI | InChI=1S/C20H16N2O4/c1-2-20(25)14-8-16-17-12(7-11-5-3-4-6-15(11)21-17)9-22(16)18(23)13(14)10-26-19(20)24/h3-8,25H,2,9-10H2,1H3 |
InChI Key | VSJKWCGYPAHWDS-UHFFFAOYSA-N |
Popularity | 12 references in papers |
Molecular Formula | C20H16N2O4 |
Molecular Weight | 348.40 g/mol |
Exact Mass | 348.11100700 g/mol |
Topological Polar Surface Area (TPSA) | 79.70 Ų |
XlogP | 1.00 |
Atomic LogP (AlogP) | 2.08 |
H-Bond Acceptor | 6 |
H-Bond Donor | 1 |
Rotatable Bonds | 1 |
(+)-Camptothecin |
CHEMBL276820 |
(+/-)Campathecin |
NSC302991 |
19-ethyl-19-hydroxy-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaene-14,18-dione |
4-ETHYL-4-HYDROXY-3,4,12,14-TETRAHYDRO-1H-PYRANO[3'4':6,7]INDOLIZINO[1,2-B]QUINOLINE-3,14-DIONE |
4-ETHYL-4-HYDROXY-3,4,12,14-TETRAHYDRO-1H-PYRANO[3'4' |
(+/-)-Camptothecine;20(RS)-Camptothecin;dl-Camptothecin |
TNP00113 |
()Campathecin |
There are more than 10 synonyms. If you wish to see them all click here. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.9168 | 91.68% |
Caco-2 | - | 0.7865 | 78.65% |
Blood Brain Barrier | - | 0.5000 | 50.00% |
Human oral bioavailability | - | 0.7286 | 72.86% |
Subcellular localzation | Lysosomes | 0.4965 | 49.65% |
OATP2B1 inhibitior | - | 1.0000 | 100.00% |
OATP1B1 inhibitior | + | 0.9414 | 94.14% |
OATP1B3 inhibitior | + | 0.9392 | 93.92% |
MATE1 inhibitior | - | 0.6400 | 64.00% |
OCT2 inhibitior | - | 0.9750 | 97.50% |
BSEP inhibitior | + | 0.6326 | 63.26% |
P-glycoprotein inhibitior | - | 0.9166 | 91.66% |
P-glycoprotein substrate | - | 0.9362 | 93.62% |
CYP3A4 substrate | + | 0.6452 | 64.52% |
CYP2C9 substrate | - | 0.8162 | 81.62% |
CYP2D6 substrate | - | 0.8777 | 87.77% |
CYP3A4 inhibition | + | 0.7959 | 79.59% |
CYP2C9 inhibition | - | 0.9070 | 90.70% |
CYP2C19 inhibition | - | 0.9025 | 90.25% |
CYP2D6 inhibition | - | 0.9232 | 92.32% |
CYP1A2 inhibition | + | 0.9106 | 91.06% |
CYP2C8 inhibition | - | 0.7385 | 73.85% |
CYP inhibitory promiscuity | - | 0.5591 | 55.91% |
UGT catelyzed | - | 0.8000 | 80.00% |
Carcinogenicity (binary) | - | 0.9000 | 90.00% |
Carcinogenicity (trinary) | Non-required | 0.4887 | 48.87% |
Eye corrosion | - | 0.9908 | 99.08% |
Eye irritation | - | 0.9603 | 96.03% |
Skin irritation | - | 0.8236 | 82.36% |
Skin corrosion | - | 0.9463 | 94.63% |
Ames mutagenesis | + | 0.5446 | 54.46% |
Human Ether-a-go-go-Related Gene inhibition | - | 0.7314 | 73.14% |
Micronuclear | + | 0.8400 | 84.00% |
Hepatotoxicity | + | 0.8000 | 80.00% |
skin sensitisation | - | 0.8823 | 88.23% |
Respiratory toxicity | + | 0.8667 | 86.67% |
Reproductive toxicity | + | 0.9444 | 94.44% |
Mitochondrial toxicity | + | 0.7750 | 77.50% |
Nephrotoxicity | + | 0.7838 | 78.38% |
Acute Oral Toxicity (c) | II | 0.7320 | 73.20% |
Estrogen receptor binding | + | 0.9322 | 93.22% |
Androgen receptor binding | + | 0.7855 | 78.55% |
Thyroid receptor binding | + | 0.6829 | 68.29% |
Glucocorticoid receptor binding | + | 0.9082 | 90.82% |
Aromatase binding | + | 0.6567 | 65.67% |
PPAR gamma | + | 0.6640 | 66.40% |
Honey bee toxicity | - | 0.9126 | 91.26% |
Biodegradation | - | 0.8750 | 87.50% |
Crustacea aquatic toxicity | + | 0.5500 | 55.00% |
Fish aquatic toxicity | + | 0.7332 | 73.32% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL4096 | P04637 | Cellular tumor antigen p53 |
25.1 nM 251.2 nM |
Potency Potency |
via Super-PRED
via Super-PRED |
CHEMBL1781 | P11387 | DNA topoisomerase I |
25 nM |
IC50 |
via Super-PRED
|
CHEMBL1293278 | O75496 | Geminin |
316.2 nM |
Potency |
via Super-PRED
|
CHEMBL4331 | P68871 | Hemoglobin beta chain |
5 nM |
Potency |
via Super-PRED
|
CHEMBL1955709 | P09651 | Heterogeneous nuclear ribonucleoprotein A1 |
82.7 nM |
Kd |
via Super-PRED
|
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha |
79.4 nM |
Potency |
via Super-PRED
|
CHEMBL1293298 | Q01453 | Peripheral myelin protein 22 |
239.3 nM |
Potency |
via Super-PRED
|
CHEMBL1293235 | P02545 | Prelamin-A/C |
5.6 nM |
Potency |
via Super-PRED
|
CHEMBL4630 | O14757 | Serine/threonine-protein kinase Chk1 |
2.1 nM |
EC50 |
via Super-PRED
|
CHEMBL2842 | P42345 | Serine/threonine-protein kinase mTOR |
46.5 nM |
Potency |
via Super-PRED
|
CHEMBL1293232 | Q16637 | Survival motor neuron protein |
28.2 nM |
Potency |
via Super-PRED
|
CHEMBL1293256 | P40225 | Thrombopoietin |
125.9 nM |
Potency |
via Super-PRED
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 96.99% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 96.83% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.36% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.81% | 91.11% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 90.91% | 94.00% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 88.87% | 93.40% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.15% | 95.56% |
CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 85.11% | 96.67% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.05% | 99.23% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 84.91% | 100.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.63% | 89.00% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 84.26% | 97.25% |
CHEMBL4208 | P20618 | Proteasome component C5 | 83.39% | 90.00% |
CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 82.87% | 85.11% |
CHEMBL220 | P22303 | Acetylcholinesterase | 81.44% | 94.45% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 81.08% | 93.99% |
CHEMBL4829 | O00763 | Acetyl-CoA carboxylase 2 | 80.14% | 98.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Camptotheca acuminata |
Didymochlaena truncatula |
Ophiorrhiza kuroiwai |
Ophiorrhiza pumila |
Rinorea anguifera |
PubChem | 2538 |
LOTUS | LTS0031974 |
wikiData | Q104918651 |