Wtlfordine
Internal ID | 75081be4-2976-41a6-b92b-e4351e0a8491 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones |
IUPAC Name | [20,22,23,25-tetraacetyloxy-21-(acetyloxymethyl)-15,26-dihydroxy-3,15,26-trimethyl-6,16-dioxo-2,5,17-trioxa-11-azapentacyclo[16.7.1.01,21.03,24.07,12]hexacosa-7(12),8,10-trien-19-yl] benzoate |
SMILES (Canonical) | CC(=O)OCC12C(C(C3C(C14C(C(C(C2OC(=O)C)OC(=O)C5=CC=CC=C5)OC(=O)C(CCC6=C(C=CC=N6)C(=O)OCC3(O4)C)(C)O)(C)O)OC(=O)C)OC(=O)C)OC(=O)C |
SMILES (Isomeric) | CC(=O)OCC12C(C(C3C(C14C(C(C(C2OC(=O)C)OC(=O)C5=CC=CC=C5)OC(=O)C(CCC6=C(C=CC=N6)C(=O)OCC3(O4)C)(C)O)(C)O)OC(=O)C)OC(=O)C)OC(=O)C |
InChI | InChI=1S/C43H49NO19/c1-21(45)55-20-42-34(59-24(4)48)30(57-22(2)46)29-32(58-23(3)47)43(42)41(8,54)33(31(35(42)60-25(5)49)61-36(50)26-13-10-9-11-14-26)62-38(52)39(6,53)17-16-28-27(15-12-18-44-28)37(51)56-19-40(29,7)63-43/h9-15,18,29-35,53-54H,16-17,19-20H2,1-8H3 |
InChI Key | XQDBHSNYTFRCNJ-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C43H49NO19 |
Molecular Weight | 883.80 g/mol |
Exact Mass | 883.28987833 g/mol |
Topological Polar Surface Area (TPSA) | 273.00 Ų |
XlogP | 1.20 |
Wtlfordine |
37239-51-3 |
CID 540150 |
Evonimine, 8-(acetyloxy)-O2-benzoyl-O2-deacetyl-8-deoxo-26-hydroxy-, (8.alpha.)- |
XQDBHSNYTFRCNJ-UHFFFAOYSA-N |
BCP13065 |
AKOS040760753 |
FT-0698332 |
[20,22,23,25-Tetraacetyloxy-21-(acetyloxymethyl)-15,26-dihydroxy-3,15,26-trimethyl-6,16-dioxo-2,5,17-trioxa-11-azapentacyclo[16.7.1.01,21.03,24.07,12]hexacosa-7(12),8,10-trien-19-yl] benzoate |
![2D Structure of Wtlfordine 2D Structure of Wtlfordine](https://plantaedb.com/storage/docs/compounds/2023/11/wtlfordine.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.78% | 85.14% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 97.72% | 86.33% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.26% | 96.09% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 97.16% | 91.49% |
CHEMBL2581 | P07339 | Cathepsin D | 96.71% | 98.95% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 95.92% | 90.17% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 95.01% | 82.69% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 94.35% | 99.23% |
CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 94.27% | 81.11% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 90.82% | 95.17% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.08% | 95.56% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 88.21% | 94.08% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 88.14% | 94.62% |
CHEMBL5028 | O14672 | ADAM10 | 87.16% | 97.50% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 86.71% | 97.25% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 86.45% | 91.11% |
CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 86.17% | 96.00% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 85.35% | 93.00% |
CHEMBL2535 | P11166 | Glucose transporter | 85.28% | 98.75% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.77% | 94.00% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 84.30% | 83.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.16% | 89.00% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 83.24% | 95.50% |
CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 82.20% | 96.67% |
CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 81.65% | 94.42% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 80.81% | 91.07% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.32% | 92.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Euonymus alatus |
Plenckia populnea |
Tripterygium wilfordii |
PubChem | 540150 |
LOTUS | LTS0191049 |
wikiData | Q105339634 |