Wedelolactone
Internal ID | 698ee248-57de-4633-80e8-95ef8b99cbcb |
Taxonomy | Phenylpropanoids and polyketides > Isoflavonoids > Coumestans |
IUPAC Name | 1,8,9-trihydroxy-3-methoxy-[1]benzofuro[3,2-c]chromen-6-one |
SMILES (Canonical) | COC1=CC(=C2C(=C1)OC(=O)C3=C2OC4=CC(=C(C=C43)O)O)O |
SMILES (Isomeric) | COC1=CC(=C2C(=C1)OC(=O)C3=C2OC4=CC(=C(C=C43)O)O)O |
InChI | InChI=1S/C16H10O7/c1-21-6-2-10(19)14-12(3-6)23-16(20)13-7-4-8(17)9(18)5-11(7)22-15(13)14/h2-5,17-19H,1H3 |
InChI Key | XQDCKJKKMFWXGB-UHFFFAOYSA-N |
Popularity | 359 references in papers |
Molecular Formula | C16H10O7 |
Molecular Weight | 314.25 g/mol |
Exact Mass | 314.04265265 g/mol |
Topological Polar Surface Area (TPSA) | 109.00 Ų |
XlogP | 2.40 |
Atomic LogP (AlogP) | 2.82 |
H-Bond Acceptor | 7 |
H-Bond Donor | 3 |
Rotatable Bonds | 1 |
524-12-9 |
7-Methoxy-5,11,12-trihydroxycoumestan |
7-Methoxy-5,11,12-trihydroxy-coumestan |
IKK Inhibitor II |
1,8,9-Trihydroxy-3-methoxycoumestan |
UNII-0K6L725GNS |
CHEMBL97453 |
0K6L725GNS |
CHEBI:10037 |
1,8,9-Trihydroxy-3-methoxy-6H-benzofuro[3,2-c]chromen-6-one |
There are more than 10 synonyms. If you wish to see them all click here. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.9352 | 93.52% |
Caco-2 | - | 0.6864 | 68.64% |
Blood Brain Barrier | - | 0.7750 | 77.50% |
Human oral bioavailability | - | 0.5000 | 50.00% |
Subcellular localzation | Mitochondria | 0.7687 | 76.87% |
OATP2B1 inhibitior | - | 0.5656 | 56.56% |
OATP1B1 inhibitior | + | 0.9373 | 93.73% |
OATP1B3 inhibitior | + | 0.9763 | 97.63% |
MATE1 inhibitior | - | 0.7600 | 76.00% |
OCT2 inhibitior | - | 0.9750 | 97.50% |
BSEP inhibitior | - | 0.9131 | 91.31% |
P-glycoprotein inhibitior | - | 0.7135 | 71.35% |
P-glycoprotein substrate | - | 0.9007 | 90.07% |
CYP3A4 substrate | - | 0.5118 | 51.18% |
CYP2C9 substrate | - | 0.8110 | 81.10% |
CYP2D6 substrate | - | 0.8370 | 83.70% |
CYP3A4 inhibition | - | 0.6101 | 61.01% |
CYP2C9 inhibition | - | 0.7604 | 76.04% |
CYP2C19 inhibition | + | 0.7410 | 74.10% |
CYP2D6 inhibition | - | 0.6626 | 66.26% |
CYP1A2 inhibition | + | 0.8474 | 84.74% |
CYP2C8 inhibition | - | 0.7351 | 73.51% |
CYP inhibitory promiscuity | - | 0.5328 | 53.28% |
UGT catelyzed | + | 0.7000 | 70.00% |
Carcinogenicity (binary) | - | 0.9900 | 99.00% |
Carcinogenicity (trinary) | Non-required | 0.3606 | 36.06% |
Eye corrosion | - | 0.9779 | 97.79% |
Eye irritation | + | 0.7632 | 76.32% |
Skin irritation | - | 0.6400 | 64.00% |
Skin corrosion | - | 0.9555 | 95.55% |
Ames mutagenesis | - | 0.5900 | 59.00% |
Human Ether-a-go-go-Related Gene inhibition | - | 0.8974 | 89.74% |
Micronuclear | + | 0.9200 | 92.00% |
Hepatotoxicity | - | 0.8000 | 80.00% |
skin sensitisation | - | 0.8470 | 84.70% |
Respiratory toxicity | + | 0.5222 | 52.22% |
Reproductive toxicity | + | 0.8778 | 87.78% |
Mitochondrial toxicity | + | 0.7500 | 75.00% |
Nephrotoxicity | - | 0.7121 | 71.21% |
Acute Oral Toxicity (c) | III | 0.5546 | 55.46% |
Estrogen receptor binding | + | 0.8617 | 86.17% |
Androgen receptor binding | + | 0.8658 | 86.58% |
Thyroid receptor binding | + | 0.6274 | 62.74% |
Glucocorticoid receptor binding | + | 0.9105 | 91.05% |
Aromatase binding | + | 0.7246 | 72.46% |
PPAR gamma | + | 0.8491 | 84.91% |
Honey bee toxicity | - | 0.8308 | 83.08% |
Biodegradation | - | 0.8000 | 80.00% |
Crustacea aquatic toxicity | - | 0.5500 | 55.00% |
Fish aquatic toxicity | + | 0.9211 | 92.11% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase |
2500 nM |
IC50 |
PMID: 11212092
|
CHEMBL1293236 | P46063 | ATP-dependent DNA helicase Q1 |
2511.9 nM 11220.2 nM 14125.4 nM |
Potency Potency Potency |
via CMAUP
via CMAUP via CMAUP |
CHEMBL1293237 | P54132 | Bloom syndrome protein |
12589.3 nM 17782.8 nM |
Potency Potency |
via CMAUP
via CMAUP |
CHEMBL5586 | P16152 | Carbonyl reductase [NADPH] 1 |
3780 nM 600 nM |
IC50 Ki |
PMID: 19097799
via Super-PRED |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase |
4466.8 nM |
Potency |
via CMAUP
|
CHEMBL1947 | P10828 | Thyroid hormone receptor beta-1 |
50118.7 nM 35481.3 nM 39810.7 nM |
Potency Potency Potency |
via CMAUP
via CMAUP via CMAUP |
CHEMBL1075138 | Q9NUW8 | Tyrosyl-DNA phosphodiesterase 1 |
1000 nM 707.9 nM 707.9 nM |
Potency Potency Potency |
via CMAUP
via CMAUP via Super-PRED |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.99% | 91.11% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 94.82% | 85.14% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.67% | 95.56% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.90% | 94.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 92.39% | 99.15% |
CHEMBL2581 | P07339 | Cathepsin D | 89.19% | 98.95% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 89.16% | 99.23% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.87% | 94.45% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.57% | 89.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.35% | 99.17% |
CHEMBL3194 | P02766 | Transthyretin | 84.20% | 90.71% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.36% | 86.33% |
CHEMBL2535 | P11166 | Glucose transporter | 82.97% | 98.75% |
CHEMBL3401 | O75469 | Pregnane X receptor | 82.17% | 94.73% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 82.06% | 91.49% |
CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 80.42% | 94.42% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Aconitum kongboense |
Eclipta prostrata |
Eclipta prostrata |
Ephedra intermedia |
Garcinia lucida |
Hypericum erectum |
Platycladus orientalis |
Sphagneticola calendulacea |
PubChem | 5281813 |
NPASS | NPC86477 |
ChEMBL | CHEMBL97453 |
LOTUS | LTS0216902 |
wikiData | Q6586709 |