Tsangane L 3-glucoside
Internal ID | d5ddb004-44b6-4367-aee5-5b57d67c0e07 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides |
IUPAC Name | 2-[4-(3-hydroxybutyl)-3,5,5-trimethylcyclohex-3-en-1-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
SMILES (Canonical) | CC1=C(C(CC(C1)OC2C(C(C(C(O2)CO)O)O)O)(C)C)CCC(C)O |
SMILES (Isomeric) | CC1=C(C(CC(C1)OC2C(C(C(C(O2)CO)O)O)O)(C)C)CCC(C)O |
InChI | InChI=1S/C19H34O7/c1-10-7-12(8-19(3,4)13(10)6-5-11(2)21)25-18-17(24)16(23)15(22)14(9-20)26-18/h11-12,14-18,20-24H,5-9H2,1-4H3 |
InChI Key | UJRMJTIXXKZFGB-UHFFFAOYSA-N |
Popularity | 4 references in papers |
Molecular Formula | C19H34O7 |
Molecular Weight | 374.50 g/mol |
Exact Mass | 374.23045342 g/mol |
Topological Polar Surface Area (TPSA) | 120.00 Ų |
XlogP | 0.20 |
CHEBI:169256 |
2-[4-(3-hydroxybutyl)-3,5,5-trimethylcyclohex-3-en-1-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.61% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.11% | 91.11% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 92.54% | 97.25% |
CHEMBL2581 | P07339 | Cathepsin D | 91.96% | 98.95% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 91.74% | 96.61% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.09% | 97.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.67% | 94.45% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.45% | 95.89% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 84.20% | 93.56% |
CHEMBL3401 | O75469 | Pregnane X receptor | 84.14% | 94.73% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 83.92% | 85.14% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 83.89% | 96.47% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 82.03% | 95.93% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 81.83% | 86.92% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 80.15% | 92.86% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 80.08% | 96.21% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Juniperus communis |
Linaria japonica |
Magnolia chevalieri |
Myrsine seguinii |
Rosa gallica |
PubChem | 73981648 |
LOTUS | LTS0081822 |
wikiData | Q105274142 |