Triglyceride
| Internal ID | f36e261b-892a-4faa-902a-a68ab52d85a6 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Tricarboxylic acids and derivatives |
| IUPAC Name | 2,3-diformyloxypropyl formate |
| SMILES (Canonical) | C(C(COC=O)OC=O)OC=O |
| SMILES (Isomeric) | C(C(COC=O)OC=O)OC=O |
| InChI | InChI=1S/C6H8O6/c7-3-10-1-6(12-5-9)2-11-4-8/h3-6H,1-2H2 |
| InChI Key | UFTFJSFQGQCHQW-UHFFFAOYSA-N |
| Popularity | 82,574 references in papers |
| Molecular Formula | C6H8O6 |
| Molecular Weight | 176.12 g/mol |
| Exact Mass | 176.03208797 g/mol |
| Topological Polar Surface Area (TPSA) | 78.90 Ų |
| XlogP | 0.00 |
| 32765-69-8 |
| glycerol triformate |
| Triglyceride |
| 2,3-diformyloxypropyl formate |
| Glyceryl triformate |
| Glycerol Triformate, Technical Grade |
| 6PG7H8DN6D |
| Propane-1,2,3-triyl triformate |
| 1,2,3-Propanetriol, 1,2,3-triformate |
| Glycerol, triformate |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 83.74% | 96.09% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 80.57% | 89.34% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Asimina triloba |
| Elaeagnus angustifolia |
| Gossypium barbadense |
| Ricinus communis |
| PubChem | 5460048 |
| LOTUS | LTS0070293 |
| wikiData | Q640625 |