(+)-Thaliporphine
Internal ID | e50fde86-a4d6-451f-8657-13df4095819d |
Taxonomy | Alkaloids and derivatives > Aporphines |
IUPAC Name | (6aS)-2,9,10-trimethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-1-ol |
SMILES (Canonical) | CN1CCC2=CC(=C(C3=C2C1CC4=CC(=C(C=C43)OC)OC)O)OC |
SMILES (Isomeric) | CN1CCC2=CC(=C(C3=C2[C@@H]1CC4=CC(=C(C=C43)OC)OC)O)OC |
InChI | InChI=1S/C20H23NO4/c1-21-6-5-11-8-17(25-4)20(22)19-13-10-16(24-3)15(23-2)9-12(13)7-14(21)18(11)19/h8-10,14,22H,5-7H2,1-4H3/t14-/m0/s1 |
InChI Key | SAERKXUSZPTMCQ-AWEZNQCLSA-N |
Popularity | 38 references in papers |
Molecular Formula | C20H23NO4 |
Molecular Weight | 341.40 g/mol |
Exact Mass | 341.16270821 g/mol |
Topological Polar Surface Area (TPSA) | 51.20 Ų |
XlogP | 2.60 |
Atomic LogP (AlogP) | 3.17 |
H-Bond Acceptor | 5 |
H-Bond Donor | 1 |
Rotatable Bonds | 3 |
(+)-Thaliporphine |
5083-88-5 |
(6As)-2,9,10-trimethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-1-ol |
Oc1c(OC)cc2CCN(C)C3Cc4cc(OC)c(OC)cc4c1c23 |
CHEMBL1397308 |
SCHEMBL14029527 |
DTXSID601345982 |
NCGC00017380-02 |
NCGC00142558-01 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.9379 | 93.79% |
Caco-2 | + | 0.8732 | 87.32% |
Blood Brain Barrier | + | 0.7250 | 72.50% |
Human oral bioavailability | - | 0.6571 | 65.71% |
Subcellular localzation | Mitochondria | 0.5800 | 58.00% |
OATP2B1 inhibitior | - | 1.0000 | 100.00% |
OATP1B1 inhibitior | + | 0.8931 | 89.31% |
OATP1B3 inhibitior | + | 0.9525 | 95.25% |
MATE1 inhibitior | - | 0.8600 | 86.00% |
OCT2 inhibitior | - | 0.5000 | 50.00% |
BSEP inhibitior | + | 0.6427 | 64.27% |
P-glycoprotein inhibitior | - | 0.7162 | 71.62% |
P-glycoprotein substrate | - | 0.6423 | 64.23% |
CYP3A4 substrate | + | 0.5995 | 59.95% |
CYP2C9 substrate | + | 0.7825 | 78.25% |
CYP2D6 substrate | + | 0.8432 | 84.32% |
CYP3A4 inhibition | - | 0.7998 | 79.98% |
CYP2C9 inhibition | - | 0.9152 | 91.52% |
CYP2C19 inhibition | - | 0.8495 | 84.95% |
CYP2D6 inhibition | + | 0.8932 | 89.32% |
CYP1A2 inhibition | + | 0.8522 | 85.22% |
CYP2C8 inhibition | - | 0.8047 | 80.47% |
CYP inhibitory promiscuity | - | 0.9463 | 94.63% |
UGT catelyzed | - | 0.5000 | 50.00% |
Carcinogenicity (binary) | - | 0.9900 | 99.00% |
Carcinogenicity (trinary) | Non-required | 0.7057 | 70.57% |
Eye corrosion | - | 0.9927 | 99.27% |
Eye irritation | - | 0.9690 | 96.90% |
Skin irritation | - | 0.7512 | 75.12% |
Skin corrosion | - | 0.9363 | 93.63% |
Ames mutagenesis | - | 0.6100 | 61.00% |
Human Ether-a-go-go-Related Gene inhibition | - | 0.3955 | 39.55% |
Micronuclear | - | 0.5600 | 56.00% |
Hepatotoxicity | - | 0.8199 | 81.99% |
skin sensitisation | - | 0.8991 | 89.91% |
Respiratory toxicity | + | 0.7667 | 76.67% |
Reproductive toxicity | + | 0.8556 | 85.56% |
Mitochondrial toxicity | + | 0.5625 | 56.25% |
Nephrotoxicity | - | 0.8974 | 89.74% |
Acute Oral Toxicity (c) | III | 0.8040 | 80.40% |
Estrogen receptor binding | + | 0.7147 | 71.47% |
Androgen receptor binding | - | 0.5984 | 59.84% |
Thyroid receptor binding | + | 0.7127 | 71.27% |
Glucocorticoid receptor binding | + | 0.8168 | 81.68% |
Aromatase binding | + | 0.5952 | 59.52% |
PPAR gamma | + | 0.7389 | 73.89% |
Honey bee toxicity | - | 0.9093 | 90.93% |
Biodegradation | - | 0.9500 | 95.00% |
Crustacea aquatic toxicity | + | 0.6200 | 62.00% |
Fish aquatic toxicity | + | 0.8720 | 87.20% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] |
14125.4 nM |
Potency |
via CMAUP
|
CHEMBL3577 | P00352 | Aldehyde dehydrogenase 1A1 |
28183.8 nM |
Potency |
via CMAUP
|
CHEMBL2903 | P16050 | Arachidonate 15-lipoxygenase |
5011.9 nM |
Potency |
via CMAUP
|
CHEMBL1293237 | P54132 | Bloom syndrome protein |
39810.7 nM |
Potency |
via CMAUP
|
CHEMBL4801 | P29466 | Caspase-1 |
25118.9 nM |
Potency |
via CMAUP
|
CHEMBL3468 | P55210 | Caspase-7 |
31622.8 nM |
Potency |
via CMAUP
|
CHEMBL4096 | P04637 | Cellular tumor antigen p53 |
31622.8 nM 12589.3 nM |
Potency Potency |
via CMAUP
via CMAUP |
CHEMBL340 | P08684 | Cytochrome P450 3A4 |
7943.3 nM 7943.3 nM |
Potency Potency |
via CMAUP
via CMAUP |
CHEMBL4159 | Q99714 | Endoplasmic reticulum-associated amyloid beta-peptide-binding protein |
31622.8 nM |
Potency |
via CMAUP
|
CHEMBL1293226 | B2RXH2 | Lysine-specific demethylase 4D-like |
34435.5 nM |
Potency |
via CMAUP
|
CHEMBL4040 | P28482 | MAP kinase ERK2 |
31622.8 nM |
Potency |
via CMAUP
|
CHEMBL1293224 | P10636 | Microtubule-associated protein tau |
5011.9 nM 5011.9 nM |
Potency Potency |
via CMAUP
via CMAUP |
CHEMBL1947 | P10828 | Thyroid hormone receptor beta-1 |
44668.4 nM 39810.7 nM |
Potency Potency |
via CMAUP
via CMAUP |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.00% | 96.09% |
CHEMBL217 | P14416 | Dopamine D2 receptor | 96.71% | 95.62% |
CHEMBL2056 | P21728 | Dopamine D1 receptor | 95.05% | 91.00% |
CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 94.77% | 91.79% |
CHEMBL2581 | P07339 | Cathepsin D | 93.61% | 98.95% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 93.18% | 92.94% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 91.56% | 91.49% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.88% | 95.56% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 89.64% | 91.11% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.25% | 95.89% |
CHEMBL4208 | P20618 | Proteasome component C5 | 88.99% | 90.00% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 87.66% | 91.03% |
CHEMBL3438 | Q05513 | Protein kinase C zeta | 87.65% | 88.48% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 87.15% | 85.14% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 87.04% | 93.40% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.83% | 86.33% |
CHEMBL5747 | Q92793 | CREB-binding protein | 85.64% | 95.12% |
CHEMBL2535 | P11166 | Glucose transporter | 83.31% | 98.75% |
CHEMBL4835 | P00338 | L-lactate dehydrogenase A chain | 82.70% | 95.34% |
CHEMBL4247 | Q9UM73 | ALK tyrosine kinase receptor | 82.32% | 96.86% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 82.14% | 89.62% |
CHEMBL3474 | P14555 | Phospholipase A2 group IIA | 81.72% | 94.05% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.48% | 94.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 81.39% | 95.89% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.04% | 90.71% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.32% | 89.00% |
CHEMBL5925 | P22413 | Ectonucleotide pyrophosphatase/phosphodiesterase family member 1 | 80.00% | 92.38% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 6992288 |
NPASS | NPC78222 |
ChEMBL | CHEMBL1397308 |
LOTUS | LTS0131877 |
wikiData | Q105248814 |