Taccalonolide T
Internal ID | 7a6781b1-4e70-44d3-8f00-8192c387b49d |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroid lactones > Withanolides and derivatives |
IUPAC Name | [(1S,2R,3R,5R,7S,9S,10R,11S,12S,14S,15R,16S,17S,22S,23S,24R,25R)-3,14,25-triacetyloxy-5,22-dihydroxy-11,15,17,22,23-pentamethyl-4,21-dioxo-8,20-dioxaheptacyclo[13.10.0.02,12.05,11.07,9.016,24.019,23]pentacos-18-en-10-yl] 3-methylbutanoate |
SMILES (Canonical) | CC1C=C2C(C3C1C4(C(CC5C(C4C3OC(=O)C)C(C(=O)C6(C5(C(C7C(C6)O7)OC(=O)CC(C)C)C)O)OC(=O)C)OC(=O)C)C)(C(C(=O)O2)(C)O)C |
SMILES (Isomeric) | C[C@@H]1C=C2[C@@]([C@H]3[C@H]1[C@]4([C@H](C[C@H]5[C@H]([C@@H]4[C@H]3OC(=O)C)[C@H](C(=O)[C@@]6([C@@]5([C@H]([C@@H]7[C@H](C6)O7)OC(=O)CC(C)C)C)O)OC(=O)C)OC(=O)C)C)([C@](C(=O)O2)(C)O)C |
InChI | InChI=1S/C39H52O14/c1-15(2)11-24(43)53-33-29-21(51-29)14-39(47)32(44)30(49-18(5)41)25-20(36(33,39)8)13-22(48-17(4)40)35(7)26-16(3)12-23-37(9,38(10,46)34(45)52-23)28(26)31(27(25)35)50-19(6)42/h12,15-16,20-22,25-31,33,46-47H,11,13-14H2,1-10H3/t16-,20+,21+,22+,25-,26+,27-,28+,29+,30-,31-,33+,35-,36+,37+,38-,39+/m1/s1 |
InChI Key | KZLSRGBNLVIVQO-PKZSBVJESA-N |
Popularity | 2 references in papers |
Molecular Formula | C39H52O14 |
Molecular Weight | 744.80 g/mol |
Exact Mass | 744.33570633 g/mol |
Topological Polar Surface Area (TPSA) | 202.00 Ų |
XlogP | 3.10 |
CHEMBL1821843 |
SCHEMBL16273034 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4040 | P28482 | MAP kinase ERK2 | 99.65% | 83.82% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 99.40% | 94.45% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.84% | 96.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.82% | 85.14% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.12% | 91.11% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.76% | 97.25% |
CHEMBL2581 | P07339 | Cathepsin D | 95.34% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.30% | 86.33% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 92.39% | 89.50% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.35% | 95.56% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 91.23% | 91.19% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 91.04% | 97.21% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 90.25% | 95.17% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.72% | 97.09% |
CHEMBL299 | P17252 | Protein kinase C alpha | 87.64% | 98.03% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 86.87% | 93.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.51% | 100.00% |
CHEMBL4208 | P20618 | Proteasome component C5 | 85.38% | 90.00% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 85.05% | 96.77% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 84.02% | 96.47% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.86% | 89.00% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 83.37% | 95.50% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.47% | 94.00% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.28% | 97.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Arabidopsis thaliana |
Lemna aequinoctialis |
Lotus tenuis |
Populus tremula |
Tacca chantrieri |
PubChem | 56658581 |
NPASS | NPC267822 |
ChEMBL | CHEMBL1821843 |
LOTUS | LTS0037861 |
wikiData | Q27078074 |