Stigmastane-3,6-dione
Internal ID | e0239462-d733-4e9a-b091-2aa3d5a7a669 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Stigmastanes and derivatives |
IUPAC Name | 17-(5-ethyl-6-methylheptan-2-yl)-10,13-dimethyl-2,4,5,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,6-dione |
SMILES (Canonical) | CCC(CCC(C)C1CCC2C1(CCC3C2CC(=O)C4C3(CCC(=O)C4)C)C)C(C)C |
SMILES (Isomeric) | CCC(CCC(C)C1CCC2C1(CCC3C2CC(=O)C4C3(CCC(=O)C4)C)C)C(C)C |
InChI | InChI=1S/C29H48O2/c1-7-20(18(2)3)9-8-19(4)23-10-11-24-22-17-27(31)26-16-21(30)12-14-29(26,6)25(22)13-15-28(23,24)5/h18-20,22-26H,7-17H2,1-6H3 |
InChI Key | HMMVBUVVQLUGQA-UHFFFAOYSA-N |
Popularity | 6 references in papers |
Molecular Formula | C29H48O2 |
Molecular Weight | 428.70 g/mol |
Exact Mass | 428.365430770 g/mol |
Topological Polar Surface Area (TPSA) | 34.10 Ų |
XlogP | 8.10 |
22149-69-5 |
14-(5-ethyl-6-methylheptan-2-yl)-2,15-dimethyltetracyclo[8.7.0.0^{2,7}.0^{11,15}]heptadecane-5,8-dione |
Stigmastane-3,6-dione,(5a)- |
LMST01040265 |
AKOS032948286 |
17-(5-ethyl-6-methylheptan-2-yl)-10,13-dimethyl-2,4,5,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,6-dione |
PD164886 |
B0005-174928 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.29% | 97.25% |
CHEMBL2581 | P07339 | Cathepsin D | 96.23% | 98.95% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.39% | 97.09% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.67% | 96.09% |
CHEMBL3837 | P07711 | Cathepsin L | 89.57% | 96.61% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.39% | 100.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.83% | 95.56% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.78% | 94.45% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 87.24% | 90.71% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 87.06% | 95.89% |
CHEMBL1871 | P10275 | Androgen Receptor | 86.75% | 96.43% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 86.07% | 96.38% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 84.39% | 93.56% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 84.32% | 91.11% |
CHEMBL1902 | P62942 | FK506-binding protein 1A | 84.31% | 97.05% |
CHEMBL236 | P41143 | Delta opioid receptor | 82.90% | 99.35% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 82.68% | 93.99% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.37% | 86.33% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 82.30% | 96.47% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 82.09% | 97.14% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 81.00% | 100.00% |
CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 80.94% | 95.58% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.72% | 95.89% |
CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 80.56% | 85.11% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 80.47% | 93.04% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.32% | 92.62% |
CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 80.06% | 94.78% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Annona ambotay |
Brucea javanica |
Conium maculatum |
Cynoglossum gansuense |
Gleditsia sinensis |
Houttuynia cordata |
Larix kaempferi |
Macaranga tanarius |
PubChem | 543599 |
LOTUS | LTS0179597 |
wikiData | Q105030580 |