Spiredine
Internal ID | 13bba0df-7351-4d59-a058-492aaf53eb5e |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids > Villanovane, atisane, trachylobane or helvifulvane diterpenoids > Atisane diterpenoids |
IUPAC Name | (1S,5R,11R,14R,17S,20S,21R)-5-methyl-15-methylidene-7-oxa-10-azaheptacyclo[12.6.2.01,11.05,20.06,10.012,17.017,21]docosane-19,22-dione |
SMILES (Canonical) | CC12CCCC34C1C(=O)CC56C3C(=O)C(CC5C4N7C2OCC7)C(=C)C6 |
SMILES (Isomeric) | C[C@@]12CCC[C@]34[C@@H]1C(=O)C[C@]56[C@H]3C(=O)[C@H](CC5[C@H]4N7C2OCC7)C(=C)C6 |
InChI | InChI=1S/C22H27NO3/c1-11-9-21-10-14(24)16-20(2)4-3-5-22(16)17(21)15(25)12(11)8-13(21)18(22)23-6-7-26-19(20)23/h12-13,16-19H,1,3-10H2,2H3/t12-,13?,16-,17-,18-,19?,20-,21+,22+/m1/s1 |
InChI Key | SMCYLHSXVDDYCA-UXTSAHMASA-N |
Popularity | 0 references in papers |
Molecular Formula | C22H27NO3 |
Molecular Weight | 353.50 g/mol |
Exact Mass | 353.19909372 g/mol |
Topological Polar Surface Area (TPSA) | 46.60 Ų |
XlogP | 1.70 |
60062-45-5 |
C08711 |
(1S,5R,11R,14R,17S,20S,21R)-5-methyl-15-methylidene-7-oxa-10-azaheptacyclo[12.6.2.01,11.05,20.06,10.012,17.017,21]docosane-19,22-dione |
CHEBI:9238 |
DTXSID90474615 |
Q27108329 |
![2D Structure of Spiredine 2D Structure of Spiredine](https://plantaedb.com/storage/docs/compounds/2023/11/spiredine.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4040 | P28482 | MAP kinase ERK2 | 97.49% | 83.82% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.76% | 97.25% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 90.90% | 96.38% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.60% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.65% | 95.56% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 86.60% | 91.11% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 86.22% | 96.77% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 85.66% | 93.04% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 84.80% | 85.14% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 84.66% | 90.71% |
CHEMBL4940 | P07195 | L-lactate dehydrogenase B chain | 84.51% | 95.53% |
CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 84.20% | 82.38% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.94% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 83.03% | 98.95% |
CHEMBL238 | Q01959 | Dopamine transporter | 82.55% | 95.88% |
CHEMBL321 | P14780 | Matrix metalloproteinase 9 | 82.38% | 92.12% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.62% | 86.33% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.43% | 100.00% |
CHEMBL228 | P31645 | Serotonin transporter | 81.36% | 95.51% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 80.52% | 82.69% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Spiraea japonica |
Thalictrum javanicum |
PubChem | 11953914 |
LOTUS | LTS0072507 |
wikiData | Q27108329 |