Spathodic acid
Internal ID | 01d23281-0a87-4b86-b9ad-51bca12a7792 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | (1S,4aR,6aR,6aS,6bR,8aR,9S,10S,12aR,14bS)-1,10-dihydroxy-9-(hydroxymethyl)-2,2,6a,6b,9,12a-hexamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylic acid |
SMILES (Canonical) | CC1(CCC2(CCC3(C(=CCC4C3(CCC5C4(CCC(C5(C)CO)O)C)C)C2C1O)C)C(=O)O)C |
SMILES (Isomeric) | C[C@]12CC[C@@H]([C@]([C@@H]1CC[C@@]3([C@@H]2CC=C4[C@]3(CC[C@@]5([C@H]4[C@@H](C(CC5)(C)C)O)C(=O)O)C)C)(C)CO)O |
InChI | InChI=1S/C30H48O5/c1-25(2)13-15-30(24(34)35)16-14-28(5)18(22(30)23(25)33)7-8-20-26(3)11-10-21(32)27(4,17-31)19(26)9-12-29(20,28)6/h7,19-23,31-33H,8-17H2,1-6H3,(H,34,35)/t19-,20-,21+,22-,23+,26+,27-,28-,29-,30+/m1/s1 |
InChI Key | TUOYZAJHBIXONX-CGSJAQJOSA-N |
Popularity | 2 references in papers |
Molecular Formula | C30H48O5 |
Molecular Weight | 488.70 g/mol |
Exact Mass | 488.35017463 g/mol |
Topological Polar Surface Area (TPSA) | 98.00 Ų |
XlogP | 5.50 |
CHEMBL493893 |
CHEBI:69529 |
D09GPV |
BDBM50253200 |
3beta,19alpha,24-trihydroxyolean-12-en-28-oic acid |
Q27137869 |
(1S,4aR,6aR,6aS,6bR,8aR,9S,10S,12aR,14bS)-1,10-dihydroxy-9-(hydroxymethyl)-2,2,6a,6b,9,12a-hexamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylic acid |
![2D Structure of Spathodic acid 2D Structure of Spathodic acid](https://plantaedb.com/storage/docs/compounds/2023/07/spathodic-acid.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B |
18800 nM |
IC50 |
PMID: 18798681
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.81% | 95.56% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.98% | 97.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 86.55% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.27% | 96.09% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.27% | 100.00% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 82.30% | 90.17% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 81.43% | 100.00% |
CHEMBL5028 | O14672 | ADAM10 | 81.05% | 97.50% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 80.72% | 93.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.17% | 94.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Diospyros kaki |
Rubia yunnanensis |
Spathodea campanulata |
PubChem | 21594148 |
NPASS | NPC229281 |
ChEMBL | CHEMBL493893 |
LOTUS | LTS0068545 |
wikiData | Q27137869 |