Sinensol D
| Internal ID | ec68d3de-fd95-4b0a-afb2-80681a3a3fee |
| Taxonomy | Organoheterocyclic compounds > Naphthopyrans |
| IUPAC Name | 7-[(4-hydroxyphenyl)methyl]-8-methoxy-2,2-dimethyl-5,6-dihydronaphtho[2,1-f]chromen-10-ol |
| SMILES (Canonical) | CC1(C=CC2=C(O1)C=CC3=C2CCC4=C3C(=CC(=C4CC5=CC=C(C=C5)O)OC)O)C |
| SMILES (Isomeric) | CC1(C=CC2=C(O1)C=CC3=C2CCC4=C3C(=CC(=C4CC5=CC=C(C=C5)O)OC)O)C |
| InChI | InChI=1S/C27H26O4/c1-27(2)13-12-19-18-8-9-21-22(14-16-4-6-17(28)7-5-16)25(30-3)15-23(29)26(21)20(18)10-11-24(19)31-27/h4-7,10-13,15,28-29H,8-9,14H2,1-3H3 |
| InChI Key | OBAJVJGJCGPZCJ-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C27H26O4 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.18310931 g/mol |
| Topological Polar Surface Area (TPSA) | 58.90 Ų |
| XlogP | 5.90 |
| CHEMBL471472 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.30% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.94% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 97.87% | 98.95% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.43% | 94.45% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 93.93% | 90.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.84% | 99.17% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 91.59% | 95.89% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 91.54% | 98.35% |
| CHEMBL2535 | P11166 | Glucose transporter | 91.22% | 98.75% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 90.74% | 91.49% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.35% | 86.33% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.53% | 94.00% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 87.58% | 93.99% |
| CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 87.21% | 95.78% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.79% | 95.56% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 86.68% | 90.20% |
| CHEMBL5747 | Q92793 | CREB-binding protein | 86.15% | 95.12% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 85.90% | 95.50% |
| CHEMBL4835 | P00338 | L-lactate dehydrogenase A chain | 84.90% | 95.34% |
| CHEMBL5555 | O00767 | Acyl-CoA desaturase | 84.79% | 97.50% |
| CHEMBL4940 | P07195 | L-lactate dehydrogenase B chain | 84.51% | 95.53% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 84.41% | 89.50% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 84.40% | 93.40% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.09% | 89.00% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 83.42% | 99.15% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 83.29% | 95.17% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 83.13% | 97.14% |
| CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 82.29% | 85.00% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.78% | 92.62% |
| CHEMBL6175 | Q9H3R0 | Lysine-specific demethylase 4C | 80.82% | 96.69% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Spiranthes sinensis |
| Spiranthes vernalis |
| PubChem | 10621720 |
| LOTUS | LTS0153061 |
| wikiData | Q105188917 |