Sequoiaflavone
Internal ID | 6e17d5d3-2006-4234-a3ca-e85f2c5c6f7d |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Biflavonoids and polyflavonoids |
IUPAC Name | 5,7-dihydroxy-8-[2-hydroxy-5-(5-hydroxy-7-methoxy-4-oxochromen-2-yl)phenyl]-2-(4-hydroxyphenyl)chromen-4-one |
SMILES (Canonical) | COC1=CC(=C2C(=C1)OC(=CC2=O)C3=CC(=C(C=C3)O)C4=C(C=C(C5=C4OC(=CC5=O)C6=CC=C(C=C6)O)O)O)O |
SMILES (Isomeric) | COC1=CC(=C2C(=C1)OC(=CC2=O)C3=CC(=C(C=C3)O)C4=C(C=C(C5=C4OC(=CC5=O)C6=CC=C(C=C6)O)O)O)O |
InChI | InChI=1S/C31H20O10/c1-39-17-9-20(34)29-23(37)12-26(40-27(29)10-17)15-4-7-19(33)18(8-15)28-21(35)11-22(36)30-24(38)13-25(41-31(28)30)14-2-5-16(32)6-3-14/h2-13,32-36H,1H3 |
InChI Key | TYUMAYSMJLPFAN-UHFFFAOYSA-N |
Popularity | 10 references in papers |
Molecular Formula | C31H20O10 |
Molecular Weight | 552.50 g/mol |
Exact Mass | 552.10564683 g/mol |
Topological Polar Surface Area (TPSA) | 163.00 Ų |
XlogP | 5.40 |
21763-71-3 |
Brakerin |
IdB-1028 |
7-O-Methylamentoflavone |
LF-2646 |
EINECS 244-574-2 |
5,7-Dihydroxy-8-[2-hydroxy-5-(5-hydroxy-7-methoxy-4-oxochromen-2-yl)phenyl]-2-(4-hydroxyphenyl)chromen-4-one |
BRN 1445484 |
3''',8-Biflavone, 4',4''',5,5'',7-pentahydroxy-7''-methoxy- |
4H-1-Benzopyran-4-one, 5,7-dihydroxy-8-(2-hydroxy-5-(5-hydroxy-7-methoxy-4-oxo-4H-1-benzopyran-2-yl)phenyl)-2-(4-hydroxyphenyl)- |
There are more than 10 synonyms. If you wish to see them all click here. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL4822 | P56817 | Beta-secretase 1 |
1400 nM |
IC50 |
PMID: 20598535
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL242 | Q92731 | Estrogen receptor beta | 99.04% | 98.35% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.29% | 91.11% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 98.29% | 99.15% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 96.33% | 94.00% |
CHEMBL2581 | P07339 | Cathepsin D | 95.88% | 98.95% |
CHEMBL3194 | P02766 | Transthyretin | 94.32% | 90.71% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.58% | 89.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.70% | 95.56% |
CHEMBL308 | P06493 | Cyclin-dependent kinase 1 | 91.73% | 91.73% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 90.89% | 91.49% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.33% | 85.14% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 89.63% | 96.21% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.31% | 86.33% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.66% | 94.45% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 86.41% | 91.71% |
CHEMBL3401 | O75469 | Pregnane X receptor | 86.11% | 94.73% |
CHEMBL4208 | P20618 | Proteasome component C5 | 85.00% | 90.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.57% | 99.23% |
CHEMBL1907 | P15144 | Aminopeptidase N | 84.26% | 93.31% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 83.99% | 86.92% |
CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 82.95% | 93.65% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.75% | 90.71% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 80.91% | 97.28% |
CHEMBL5284 | Q96RR4 | CaM-kinase kinase beta | 80.62% | 89.23% |
CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 80.37% | 93.10% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 5484010 |
NPASS | NPC194593 |
ChEMBL | CHEMBL255493 |
LOTUS | LTS0110302 |
wikiData | Q83046486 |