(E)-N-[(3S,5S,8R,9S,10S,13S,14S,17S)-17-[(1S)-1-(dimethylamino)ethyl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]-N,3,4-trimethylpent-2-enamide
Internal ID | be27a170-e642-4164-8aa2-42a24299edbc |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Azasteroids and derivatives |
IUPAC Name | (E)-N-[(3S,5S,8R,9S,10S,13S,14S,17S)-17-[(1S)-1-(dimethylamino)ethyl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]-N,3,4-trimethylpent-2-enamide |
SMILES (Canonical) | CC(C)C(=CC(=O)N(C)C1CCC2(C(C1)CCC3C2CCC4(C3CCC4C(C)N(C)C)C)C)C |
SMILES (Isomeric) | C[C@@H]([C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC[C@@H]4[C@@]3(CC[C@@H](C4)N(C)C(=O)/C=C(\C)/C(C)C)C)C)N(C)C |
InChI | InChI=1S/C31H54N2O/c1-20(2)21(3)18-29(34)33(9)24-14-16-30(5)23(19-24)10-11-25-27-13-12-26(22(4)32(7)8)31(27,6)17-15-28(25)30/h18,20,22-28H,10-17,19H2,1-9H3/b21-18+/t22-,23-,24-,25-,26+,27-,28-,30-,31+/m0/s1 |
InChI Key | WCBPBBFIAODRLI-AWUJJIRRSA-N |
Popularity | 4 references in papers |
Molecular Formula | C31H54N2O |
Molecular Weight | 470.80 g/mol |
Exact Mass | 470.423614350 g/mol |
Topological Polar Surface Area (TPSA) | 23.60 Ų |
XlogP | 8.30 |
Atomic LogP (AlogP) | 7.02 |
H-Bond Acceptor | 2 |
H-Bond Donor | 0 |
Rotatable Bonds | 5 |
Salignenamide F |
BDBM50135153 |
(E)-3,4-Dimethyl-pent-2-enoic acid [(3S,5S,8R,9S,10S,13S,14S,17S)-17-((S)-1-dimethylamino-ethyl)-10,13-dimethyl-hexadecahydro-cyclopenta[a]phenanthren-3-yl]-methyl-amide |
3,4-Dimethyl-pent-2-enoic acid [(3S,5S,8R,9S,10S,13S,14S,17S)-17-(1-dimethylamino-ethyl)-10-methyl-13-(S)-methyl-hexadecahydro-cyclopenta[a]phenanthren-3-yl]-methyl-amide |
![2D Structure of (E)-N-[(3S,5S,8R,9S,10S,13S,14S,17S)-17-[(1S)-1-(dimethylamino)ethyl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]-N,3,4-trimethylpent-2-enamide 2D Structure of (E)-N-[(3S,5S,8R,9S,10S,13S,14S,17S)-17-[(1S)-1-(dimethylamino)ethyl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]-N,3,4-trimethylpent-2-enamide](https://plantaedb.com/storage/docs/compounds/2023/07/salignenamide-f.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.9855 | 98.55% |
Caco-2 | - | 0.6222 | 62.22% |
Blood Brain Barrier | + | 0.9000 | 90.00% |
Human oral bioavailability | - | 0.5571 | 55.71% |
Subcellular localzation | Plasma membrane | 0.3478 | 34.78% |
OATP2B1 inhibitior | - | 0.7194 | 71.94% |
OATP1B1 inhibitior | + | 0.8312 | 83.12% |
OATP1B3 inhibitior | + | 0.9339 | 93.39% |
MATE1 inhibitior | - | 0.7027 | 70.27% |
OCT2 inhibitior | + | 0.5250 | 52.50% |
BSEP inhibitior | + | 0.8546 | 85.46% |
P-glycoprotein inhibitior | + | 0.6690 | 66.90% |
P-glycoprotein substrate | - | 0.5656 | 56.56% |
CYP3A4 substrate | + | 0.7354 | 73.54% |
CYP2C9 substrate | - | 1.0000 | 100.00% |
CYP2D6 substrate | - | 0.8086 | 80.86% |
CYP3A4 inhibition | - | 0.6791 | 67.91% |
CYP2C9 inhibition | - | 0.5645 | 56.45% |
CYP2C19 inhibition | - | 0.6483 | 64.83% |
CYP2D6 inhibition | - | 0.8993 | 89.93% |
CYP1A2 inhibition | - | 0.7196 | 71.96% |
CYP2C8 inhibition | - | 0.7633 | 76.33% |
CYP inhibitory promiscuity | + | 0.5654 | 56.54% |
UGT catelyzed | - | 0.0000 | 0.00% |
Carcinogenicity (binary) | - | 0.8200 | 82.00% |
Carcinogenicity (trinary) | Non-required | 0.5850 | 58.50% |
Eye corrosion | - | 0.9689 | 96.89% |
Eye irritation | - | 0.9503 | 95.03% |
Skin irritation | - | 0.6586 | 65.86% |
Skin corrosion | - | 0.7481 | 74.81% |
Ames mutagenesis | - | 0.6500 | 65.00% |
Human Ether-a-go-go-Related Gene inhibition | - | 0.3670 | 36.70% |
Micronuclear | - | 0.7200 | 72.00% |
Hepatotoxicity | + | 0.5558 | 55.58% |
skin sensitisation | - | 0.7708 | 77.08% |
Respiratory toxicity | + | 0.8556 | 85.56% |
Reproductive toxicity | + | 0.6000 | 60.00% |
Mitochondrial toxicity | + | 0.7750 | 77.50% |
Nephrotoxicity | - | 0.8450 | 84.50% |
Acute Oral Toxicity (c) | III | 0.5734 | 57.34% |
Estrogen receptor binding | + | 0.8090 | 80.90% |
Androgen receptor binding | + | 0.7943 | 79.43% |
Thyroid receptor binding | + | 0.5645 | 56.45% |
Glucocorticoid receptor binding | + | 0.6509 | 65.09% |
Aromatase binding | + | 0.5983 | 59.83% |
PPAR gamma | + | 0.6706 | 67.06% |
Honey bee toxicity | - | 0.6859 | 68.59% |
Biodegradation | - | 0.8750 | 87.50% |
Crustacea aquatic toxicity | - | 0.5000 | 50.00% |
Fish aquatic toxicity | + | 0.9846 | 98.46% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL220 | P22303 | Acetylcholinesterase |
6456.54 nM |
IC50 |
PMID: 14643329
|
CHEMBL1914 | P06276 | Butyrylcholinesterase |
4070 nM |
IC50 |
PMID: 14584959
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.78% | 96.09% |
CHEMBL204 | P00734 | Thrombin | 93.91% | 96.01% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 92.66% | 97.25% |
CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 92.28% | 98.75% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.83% | 91.11% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 91.49% | 100.00% |
CHEMBL237 | P41145 | Kappa opioid receptor | 91.35% | 98.10% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 90.47% | 96.77% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 89.15% | 91.19% |
CHEMBL1871 | P10275 | Androgen Receptor | 88.29% | 96.43% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 88.29% | 95.89% |
CHEMBL3837 | P07711 | Cathepsin L | 87.77% | 96.61% |
CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 85.45% | 97.47% |
CHEMBL4370 | P16662 | UDP-glucuronosyltransferase 2B7 | 84.73% | 100.00% |
CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 84.56% | 97.50% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.53% | 94.45% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 84.12% | 90.71% |
CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 83.80% | 85.31% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 83.74% | 91.03% |
CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 83.51% | 85.30% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 82.84% | 96.47% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 82.79% | 94.33% |
CHEMBL236 | P41143 | Delta opioid receptor | 82.39% | 99.35% |
CHEMBL4225 | P49760 | Dual specificity protein kinase CLK2 | 81.85% | 80.96% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.40% | 89.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.36% | 95.56% |
CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 81.26% | 95.71% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 81.17% | 93.00% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.35% | 92.62% |
CHEMBL2514 | O95665 | Neurotensin receptor 2 | 80.17% | 100.00% |
CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 80.06% | 85.11% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Alpinia galanga |
Ampelopsis japonica |
Cneorum pulverulentum |
Sarcococca hookeriana |
Sarcococca saligna |
PubChem | 11113449 |
NPASS | NPC147513 |
ChEMBL | CHEMBL344593 |
LOTUS | LTS0168741 |
wikiData | Q104667141 |