S-Dihydrowogonin
Internal ID | 6e8e8ffd-91ff-46b1-b8b2-a642dc365252 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > O-methylated flavonoids > 8-O-methylated flavonoids |
IUPAC Name | (2S)-5,7-dihydroxy-8-methoxy-2-phenyl-2,3-dihydrochromen-4-one |
SMILES (Canonical) | COC1=C(C=C(C2=C1OC(CC2=O)C3=CC=CC=C3)O)O |
SMILES (Isomeric) | COC1=C(C=C(C2=C1O[C@@H](CC2=O)C3=CC=CC=C3)O)O |
InChI | InChI=1S/C16H14O5/c1-20-15-12(19)7-10(17)14-11(18)8-13(21-16(14)15)9-5-3-2-4-6-9/h2-7,13,17,19H,8H2,1H3/t13-/m0/s1 |
InChI Key | FKAOWOSRYSMEBS-ZDUSSCGKSA-N |
Popularity | 2 references in papers |
Molecular Formula | C16H14O5 |
Molecular Weight | 286.28 g/mol |
Exact Mass | 286.08412354 g/mol |
Topological Polar Surface Area (TPSA) | 76.00 Ų |
XlogP | 2.70 |
8-methoxypinocembrin |
DTXSID501317318 |
(S)-5,7-Dihydroxy-8-methoxy-2-phenylchroman-4-one |
CU5 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.67% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.52% | 95.56% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.82% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 91.52% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.18% | 86.33% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 89.44% | 99.23% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 86.75% | 85.14% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 83.67% | 99.15% |
CHEMBL2535 | P11166 | Glucose transporter | 83.04% | 98.75% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.42% | 97.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.67% | 89.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.66% | 94.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Helichrysum cymosum |
Isodon oresbius |
Piper bowiei |
Prunus avium |
Pyracantha coccinea |
PubChem | 10265977 |
LOTUS | LTS0269435 |
wikiData | Q104996448 |