(S)-1-((S)-1-Methylpyrrolidin-2-yl)propan-2-ol
Internal ID | 41f3eba9-33b2-4384-a0ea-10602e0d1a09 |
Taxonomy | Organoheterocyclic compounds > Pyrrolidines > N-alkylpyrrolidines |
IUPAC Name | (2S)-1-[(2S)-1-methylpyrrolidin-2-yl]propan-2-ol |
SMILES (Canonical) | CC(CC1CCCN1C)O |
SMILES (Isomeric) | C[C@@H](C[C@@H]1CCCN1C)O |
InChI | InChI=1S/C8H17NO/c1-7(10)6-8-4-3-5-9(8)2/h7-8,10H,3-6H2,1-2H3/t7-,8-/m0/s1 |
InChI Key | CWMYODFAUAJKIV-YUMQZZPRSA-N |
Popularity | 0 references in papers |
Molecular Formula | C8H17NO |
Molecular Weight | 143.23 g/mol |
Exact Mass | 143.131014166 g/mol |
Topological Polar Surface Area (TPSA) | 23.50 Ų |
XlogP | 0.90 |
1617-83-0 |
Hygroline A/B |
46KH4DG6WA |
HYGROLINE, (-)- |
(2S,2'S)-HYGROLINE |
CWMYODFAUAJKIV-YUMQZZPRSA-N |
AKOS016023675 |
(.ALPHA.S,2S)-.ALPHA.,1-DIMETHYL-2-PYRROLIDINEETHANOL |
2-PYRROLIDINEETHANOL, .ALPHA.,1-DIMETHYL-, (.ALPHA.S,2S)- |
2-PYRROLIDINEETHANOL, .ALPHA.,1-DIMETHYL-, (S-(R*,R*))- |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.93% | 97.25% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.62% | 96.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.53% | 85.14% |
CHEMBL2581 | P07339 | Cathepsin D | 93.58% | 98.95% |
CHEMBL5203 | P33316 | dUTP pyrophosphatase | 93.33% | 99.18% |
CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 92.37% | 95.58% |
CHEMBL2140 | P48775 | Tryptophan 2,3-dioxygenase | 87.41% | 98.46% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.28% | 95.89% |
CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 85.00% | 98.33% |
CHEMBL4835 | P00338 | L-lactate dehydrogenase A chain | 84.31% | 95.34% |
CHEMBL2730 | P21980 | Protein-glutamine gamma-glutamyltransferase | 83.77% | 92.38% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 83.62% | 96.38% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 83.46% | 96.47% |
CHEMBL3837 | P07711 | Cathepsin L | 81.29% | 96.61% |
CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 81.15% | 95.00% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 80.39% | 93.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Picea breweriana |
Schizanthus grahamii |
Schizanthus hookeri |
PubChem | 11029951 |
LOTUS | LTS0250330 |
wikiData | Q104971397 |