Rosmarinate
| Internal ID | caee56a0-4588-4b51-ad12-645ba7d95946 |
| Taxonomy | Phenylpropanoids and polyketides > Cinnamic acids and derivatives > Hydroxycinnamic acids and derivatives > Coumaric acids and derivatives |
| IUPAC Name | 3-(3,4-dihydroxyphenyl)-2-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxypropanoic acid |
| SMILES (Canonical) | C1=CC(=C(C=C1CC(C(=O)O)OC(=O)C=CC2=CC(=C(C=C2)O)O)O)O |
| SMILES (Isomeric) | C1=CC(=C(C=C1CC(C(=O)O)OC(=O)/C=C/C2=CC(=C(C=C2)O)O)O)O |
| InChI | InChI=1S/C18H16O8/c19-12-4-1-10(7-14(12)21)3-6-17(23)26-16(18(24)25)9-11-2-5-13(20)15(22)8-11/h1-8,16,19-22H,9H2,(H,24,25)/b6-3+ |
| InChI Key | DOUMFZQKYFQNTF-ZZXKWVIFSA-N |
| Popularity | 212 references in papers |
| Molecular Formula | C18H16O8 |
| Molecular Weight | 360.30 g/mol |
| Exact Mass | 360.08451746 g/mol |
| Topological Polar Surface Area (TPSA) | 145.00 Ų |
| XlogP | 2.40 |
| Atomic LogP (AlogP) | 1.76 |
| H-Bond Acceptor | 7 |
| H-Bond Donor | 5 |
| Rotatable Bonds | 6 |
| 3-(3,4-Dihydroxyphenyl)-2-((E)-3-(3,4-Dihydroxyphenyl)Prop-2-Enoyl)Oxypropanoic Acid |
| RefChem:1066647 |
| Rosmarinic acid (racemate) |
| CHEMBL66966 |
| NSC687846 |
| Benzenepropanoic acid,a-[[3-(3,4-dihydroxyphenyl)-1-oxo-2-propenyl]oxy]-3,4-dihydroxy- |
| rosmarinate acid |
| 2-[(2E)-3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-3-(3,4-dihydroxyphenyl)propano ic acid |
| 3-(3,4-dihydroxyphenyl)-2-[(2E)-3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]propanoic acid |
| SR-01000597653 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.8756 | 87.56% |
| Caco-2 | - | 0.9373 | 93.73% |
| Blood Brain Barrier | - | 0.5500 | 55.00% |
| Human oral bioavailability | - | 0.7000 | 70.00% |
| Subcellular localzation | Mitochondria | 0.8306 | 83.06% |
| OATP2B1 inhibitior | - | 0.5749 | 57.49% |
| OATP1B1 inhibitior | + | 0.9413 | 94.13% |
| OATP1B3 inhibitior | + | 0.9479 | 94.79% |
| MATE1 inhibitior | + | 0.5200 | 52.00% |
| OCT2 inhibitior | - | 0.8250 | 82.50% |
| BSEP inhibitior | + | 0.6882 | 68.82% |
| P-glycoprotein inhibitior | - | 0.8529 | 85.29% |
| P-glycoprotein substrate | - | 0.9340 | 93.40% |
| CYP3A4 substrate | - | 0.5802 | 58.02% |
| CYP2C9 substrate | - | 0.5979 | 59.79% |
| CYP2D6 substrate | - | 0.8612 | 86.12% |
| CYP3A4 inhibition | - | 0.8309 | 83.09% |
| CYP2C9 inhibition | - | 0.8754 | 87.54% |
| CYP2C19 inhibition | - | 0.9026 | 90.26% |
| CYP2D6 inhibition | - | 0.9231 | 92.31% |
| CYP1A2 inhibition | - | 0.6279 | 62.79% |
| CYP2C8 inhibition | + | 0.5112 | 51.12% |
| CYP inhibitory promiscuity | - | 0.8300 | 83.00% |
| UGT catelyzed | + | 0.7000 | 70.00% |
| Carcinogenicity (binary) | - | 0.8141 | 81.41% |
| Carcinogenicity (trinary) | Non-required | 0.6152 | 61.52% |
| Eye corrosion | - | 0.9895 | 98.95% |
| Eye irritation | + | 0.5264 | 52.64% |
| Skin irritation | - | 0.7211 | 72.11% |
| Skin corrosion | - | 0.9416 | 94.16% |
| Ames mutagenesis | - | 0.7200 | 72.00% |
| Human Ether-a-go-go-Related Gene inhibition | - | 0.4806 | 48.06% |
| Micronuclear | + | 0.7159 | 71.59% |
| Hepatotoxicity | - | 0.6250 | 62.50% |
| skin sensitisation | - | 0.5655 | 56.55% |
| Respiratory toxicity | + | 0.5556 | 55.56% |
| Reproductive toxicity | + | 0.6556 | 65.56% |
| Mitochondrial toxicity | + | 0.5625 | 56.25% |
| Nephrotoxicity | - | 0.8974 | 89.74% |
| Acute Oral Toxicity (c) | III | 0.7720 | 77.20% |
| Estrogen receptor binding | + | 0.8228 | 82.28% |
| Androgen receptor binding | + | 0.8585 | 85.85% |
| Thyroid receptor binding | + | 0.5265 | 52.65% |
| Glucocorticoid receptor binding | + | 0.6399 | 63.99% |
| Aromatase binding | - | 0.5927 | 59.27% |
| PPAR gamma | + | 0.5798 | 57.98% |
| Honey bee toxicity | - | 0.7466 | 74.66% |
| Biodegradation | - | 0.8750 | 87.50% |
| Crustacea aquatic toxicity | - | 0.5900 | 59.00% |
| Fish aquatic toxicity | + | 0.9952 | 99.52% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] |
22387.2 nM |
Potency |
via CMAUP
|
| CHEMBL1293236 | P46063 | ATP-dependent DNA helicase Q1 |
12589.3 nM |
Potency |
via CMAUP
|
| CHEMBL2392 | P06746 | DNA polymerase beta |
223.9 nM 1995.3 nM |
Potency Potency |
via Super-PRED
via CMAUP |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase |
631 nM |
Potency |
via Super-PRED
|
| CHEMBL4159 | Q99714 | Endoplasmic reticulum-associated amyloid beta-peptide-binding protein |
15848.9 nM 25.1 nM |
Potency Potency |
via CMAUP
via Super-PRED |
| CHEMBL1293226 | B2RXH2 | Lysine-specific demethylase 4D-like |
3981.1 nM 25118.9 nM |
Potency Potency |
via CMAUP
via CMAUP |
| CHEMBL2608 | P10253 | Lysosomal alpha-glucosidase |
1995.3 nM |
Potency |
via CMAUP
|
| CHEMBL1293224 | P10636 | Microtubule-associated protein tau |
12589.3 nM 14125.4 nM |
Potency Potency |
via CMAUP
via CMAUP |
| CHEMBL1075138 | Q9NUW8 | Tyrosyl-DNA phosphodiesterase 1 |
8912.5 nM 891.3 nM 223.9 nM 891.3 nM |
Potency Potency Potency Potency |
via CMAUP
via CMAUP via Super-PRED via Super-PRED |
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1951 | P21397 | Monoamine oxidase A | 98.69% | 91.49% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.94% | 86.33% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 93.33% | 96.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.20% | 94.45% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.01% | 99.17% |
| CHEMBL3194 | P02766 | Transthyretin | 92.66% | 90.71% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 92.41% | 83.82% |
| CHEMBL2581 | P07339 | Cathepsin D | 91.23% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.96% | 95.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.95% | 96.09% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 88.66% | 90.17% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 88.08% | 99.15% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 87.53% | 95.50% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 87.43% | 91.71% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 81.75% | 90.20% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Foeniculum vulgare |
| Isodon rubescens |
| Lycopus lucidus |
| Mentha canadensis |
| Perilla frutescens |
| Prunus mume |
| Salvia miltiorrhiza |
| PubChem | 5315615 |
| NPASS | NPC25581 |
| ChEMBL | CHEMBL66966 |
| LOTUS | LTS0092757 |
| wikiData | Q7762 |